A sample of metal has a mass of 20.11 g, and a volume of 6.03 mL. What is the density of this metal?

The mass of the Pyrex glass that absorbs 1940J of energy is 79.52grams.

The mass in a calorimetry procedure can be calculated using the following formula:

Q = mc∆T

Where;

According to this question, an unknown mass of each of the following substances, initially at 23.0∘C , absorbs 1940 J of heat. The final temperature is recorded as indicated. The mass can be calculated as follows:

1940 = m × 0.753 × (55.4°C - 23.0°C)

1940 = 24.39m

m = 79.52grams.

Therefore, 79.52grams is the mass of the pyrex glass.

Learn more about mass at: https://brainly.com/question/28992424

#SPJ1

Answer:

In Thomas Cole's painting "The Oxbow," Thomas Cole, the artist, shows himself sitting in the landscape while painting it.

Explanation:

In the painting called "The Oxbow" by Thomas Cole, the artist actually put himself in the picture. He's sitting right in the middle of the landscape, just like he placed himself in the painting, as if taking a selfie while working on it. It's like he took a snapshot of himself while he was working on the painting. This shows how much he cared about creating the artwork and how he felt a personal connection to the beautiful scenery. It's really fascinating because it gives us a glimpse into how he saw himself as an artist and how he wanted to capture the incredible beauty of nature through his art.

A molecule is essentially created by a collection of atoms linked by a network of bonds.

Answer:

Copper Copper Copper Copper

There are several factors that can contribute to the speed of an object, including its mass, shape, and the surface it is moving on. In general, slimmer objects tend to go faster than objects with more structure because they offer less resistance to movement, which allows them to accelerate more quickly and reach higher speeds.

One factor that can affect the speed of an object is its mass, or the amount of matter it contains. All other things being equal, an object with a lower mass will tend to be faster than an object with a higher mass, because it has less matter to move and therefore requires less energy to accelerate.

Another factor that can affect the speed of an object is its shape, or the way it is structured. Slimmer objects tend to be more streamlined, meaning they have a shape that allows them to move through the air or water with less resistance. This can allow them to go faster than more structured objects, which may have a shape that creates more drag or resistance to movement.

Finally, the surface an object is moving on can also affect its speed. For example, an object moving on a smooth, flat surface may be able to go faster than an object moving on a rough or uneven surface, because the smooth surface offers less resistance to movement.

Overall, the speed of an object is determined by a combination of these and other factors, including the force applied to the object and the level of resistance it encounters. Slimmer objects tend to go faster than objects with more structure because they offer less resistance to movement, which allows them to accelerate more quickly and reach higher speeds.

A liquid substance that could be used in the laboratory for dissolving dry mortar on floor tiles is vinegar; (i) removing KMnO₄, stains is sodium metabisulfite solution; drying acid anhydrides is concentrated sulfuric acid.

Solvents are substances usually liquids, but may also be gases or solids that dissolve other substances known as solutes.

Solvents are usually used as cleansing agents.

One possible liquid substance that could be used for dissolving dry mortar on floor tiles is a mild acid solution, such as diluted hydrochloric acid or vinegar.

KMnO₄ stains are often difficult to remove, but one substance that can be used is sodium metabisulfite (Na₂S₂O₅) solution. Sodium metabisulfite acts as a reducing agent and can effectively neutralize and remove KMnO₄ stains.

Concentrated sulfuric acid is commonly used in the laboratory as a drying agent. It has a strong affinity for water and can efficiently absorb moisture, including water present in acid anhydrides.

Learn more about solvents at: https://brainly.com/question/25326161

#SPJ1

Answer:

Kr- Dispersion Forces

H2O- Hydrogen Bonding

CHCI3- Dipole-Dipole Forces

HF- Hydrogen Bonding

C2H6- Dispersion Forces

HBr- Hydrogen Bonding Forces

Explanation:

Dispersion forces occurs in all substances. They are the dominant intermolecular interaction in all non polar substances such as C2H6 and Kr.

Hydrogen bonding occurs when hydrogen is bonded to a highly electronegative atom such as Cl, Br, O etc. It is the dominant intermolecular interaction in HF, HBr and H2O.

Dipole-Dipole interactions occur when a permanent dipole exists in a molecule such as in CHCI3

Considering the definition of molar mass, the correct answer is option c): the mass of 1.85 moles H₂O₂ is 62.9 grams.

The molar mass of substance is a property defined as the amount of mass that a substance contains in one mole.

The molar mass of a compound is the sum of the molar mass of the elements that form it (whose value is found in the periodic table) multiplied by the number of times they appear in the compound.

In this case, you know the molar mass of the elements is:

So, the molar mass of the compound H₂O₂ is calculated as:

H₂O₂= 2× 1 g/mole + 2× 16 g/mole

Solving:

H₂O₂= 34 g/mole

You can apply the following rule of three: If by definition of molar mass 1 mole of the compound contains 34 grams, 1.85 moles of the compound contains how much mass?

mass= (1.85 moles× 34 grams)÷ 1 mole

mass= 62.9 grams

Finally, the mass of 1.85 moles H₂O₂ is 62.9 grams.

Learn more about molar mass:

brainly.com/question/5216907

#SPJ1

Ga3+ do not have the ground state electron configuration of a noble gas.

electron configuration:

The arrangement of electrons in the atomic orbitals of an atom is called the electron configuration.

Noble gases have completely filled orbitals and belongs to group 18 which has outermost electronic configuration of ns2np6, where n is highest shell/period.

Ca2+ has an electronic configuration of [Ar]

Cl- has an electronic configuration of [Ar]

H- has an electronic configuration of [He]

Al3+ has an electronic configuration of [Ne]

Ga3+ has an electronic configuration of [Ar]d10

since, ga3+ has outermost electrons in its d subshell so, it do not have the ground state electron configuration of a noble gas.

learn more about electronic configuration:

https://brainly.com/question/29757010

#SPJ4

Answer:

1.14 × 10³ mL

Explanation:

Step 1: Given data

Step 2: Calculate the final volume of the gas

If we assume ideal behavior, we can calculate the final volume of the gas using Boyle's law.

P₁ × V₁ = P₂ × V₂

V₂ = P₁ × V₁/P₂

V₂ = 0.884 atm × 656.0 mL/0.510 atm = 1.14 × 10³ mL

Answer:

A smaller temperature difference causes a smaller heat transfer

Explanation:

The greater the temperature difference, the greater the rate at which heat transfers.

Answer:

I'm pretty sure it's A. BRUSH

Explanation:

If I'm wrong let ne know please

Answer:

B.BRUSHES

Explanation:

Answer:

The specific heat of the metal is 0.223 J/(g·°C).

Explanation:

We can use the formula:

Q = m * c * ΔT

where Q is the amount of heat transferred, m is the mass of the metal, c is the specific heat of the metal, and ΔT is the change in temperature.

In this case, we know that the mass of the metal is 135 g, the change in temperature is ΔT = 100.0°C - 19.5°C = 80.5°C, and the amount of heat transferred is Q = 2.50 kJ = 2500 J.

Substituting these values into the formula and solving for c, we get:

c = Q / (m * ΔT)

c = 2500 J / (135 g * 80.5°C)

c = 0.223 J/(g·°C)

Therefore, the specific heat of the metal is 0.223 J/(g·°C).

Answer: 0.230 J/g°C  

Explanation:

The equation of amount of heat gained/lost by a sample is defined as:

                                q = mCΔT

With q being the energy, m being the mass, C being the specific heat of the sample, and ΔT being the change in temperature. When solving for C, you get the equation:

                                C = \(\frac{q}{m(T_{f}-T_{i}) }\)

When you plug in your values, you get the answer:

                                  C =  \(\frac{2 500 J}{(135 g)(100.0-19.5) }\) = 0.230 J/g°C  

Answer:

I think the answer is A

Explanation:

the temperature of solids , liquids and gases can be easily measured

The term mole concept is used here to determine the mass of sulfur dioxide.The mass of sulfur dioxide obtained from 50.0 g of hydrogen sulphide is 93.93 g.

One mole of a substance is defined as that quantity of it which contains as many entities as there are atoms exactly in 12 g of carbon - 12. The formula used to calculate the number of moles is:

Number of moles = Given mass / Molar mass

Here balanced reaction is:

2H₂S + 3O₂ → 2SO₂ + 2H₂O

n (H₂S) = n(SO₂)

n = 50.0 / 34.1 = 1.466

Molar mass of sulfur dioxide = 64.067 g/mol

Mass = n × M

m = 1.466 × 64.067 = 93.93 g

To know more about mole concept, visit;

https://brainly.com/question/19730733

#SPJ1

Answer:

My hypothesis is that: If the electrolyte source is changed (potato, apple, lime, lemon), then the production of energy (measured in volts) using a lemon will produce the highest voltage because the acid content in the fruit or vegetable will produce electricity when in contact with the electrodes (both zinc and copper

Explanation:

Answer:

8.86 grams per cubic centimeter

Density: 8.86 grams per cubic centimeter

Explanation:

Answer:

i think the correct answer is A

Answer:

If you're ever shaving in the bathroom, turn the water off.

Explanation:

If you do this, you can save at least 3-4 pounds of water.

Answer:

The following activities can help conserve water while taking showers:

1) Lower shower time

2) Don't leave shower running.

3) Check for leaks

A rainbow is produced through a proces that includes refraction, reflection, and dispersion of  sunlight.

A rainbow is formed when sulinght is refracted and reflected by rain drops in the atmospher.

The sunlight is split into its component colors, which is why rainbows appear as having an array of colors. This is due to each color being bent by a different amount during refraction.

The colors of a rainbow are always in the same order, with red on the outside and violet on the inside.

Find more exercises on rainbows;

https://brainly.com/question/7965811

#SPJ1

The density of the substance is 200 kg/m³.

Density can be defined as the ratio of the mass and volume of an object.

The S.I unit of Density is kg/m³.

The formula of density of the substance is given as,

Formula:

Where:

From the diagram,

Substitute these values into equation 1

Hence, the density of the substance is 200 kg/m³.

Learn more about density here: https://brainly.com/question/1354972

#SPJ1

Answer:

It would be 200

Explanation:

Thank you

Answer:

magma

Explanation:

brainly me and il give reason in comment

Option d. First order in A and zero order in B. The reaction rate can be determined by the rate of change of concentration of the reactant over time.

In this case, the reaction is first order in A, meaning the reaction rate is proportional to the concentration of A. This can be seen as the reaction rate is the same even when the concentration of B is changed, implying that B has no effect on the reaction rate. On the other hand, the reaction is zero order in B, meaning the reaction rate is independent of the concentration of B. This means that the reaction rate is proportional to the concentration of A and is independent of the concentration of B. This can be observed from the fact that the reaction rate remains the same when the concentration of B is changed, implying that B has no effect on the reaction rate. On the other hand, the reaction rate is directly proportional to the concentration of A, meaning that as the concentration of A increases, the reaction rate also increases. Therefore, the reaction is first order in A and zero order in B.

Learn more about chemical reaction here: brainly.com/question/29762834

#SPJ4

(a) Partial pressure of Ne is 470 torr. (b) Partial pressure of of CF₄ is 110 torr. (c) Total pressure is 580 torr. (d) Mole fraction of Ne is 0.621.

(a) The initial pressure of Ne is 470 torr, so the partial pressure of Ne after mixing is also 470 torr.

(b) The initial pressure of CF₄ is 110 torr, so the partial pressure of CF₄ after mixing is also 110 torr.

(c) The total pressure is the sum of the partial pressures of the two gases:

Total pressure = partial pressure of Ne + partial pressure of CF₄

Total pressure = 470 torr + 110 torr

Total pressure = 580 torr

(d) To find the mole fraction of Ne, we need to know the number of moles of Ne and CF₄. We can use the ideal gas law to find the number of moles of each gas:

PV = nRT

n = PV/RT

For Ne:

n = (470 torr x 1.50 L)/(0.0821 L·atm/mol·K x 298 K)

n = 19.25 mol

For CF₄:

n = (110 torr x 2.50 L)/(0.0821 L·atm/mol·K x 298 K)

n = 11.72 mol

The total number of moles is:

nTotal = nNe + nCF₄

nTotal = 19.25 mol + 11.72 mol

nTotal = 30.97 mol

The mole fraction of Ne is:

XNe = nNe/nTotal

XNe = 19.25 mol/30.97 mol

XNe = 0.621

Therefore, the mole fraction of Ne is 0.621.

To know more about partial pressure please refer: https://brainly.com/question/16749630

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

a) The balanced chemical equation for the reaction is: 2H₂ + O₂ → 2H₂O

b) the number of moles of O₂ required is approximately 1.004 moles.

c)  approximately 45 liters of H₂ and 22.5 liters of O₂ are needed to obtain 45 liters of H₂O.

a) Balancing the chemical equation:

The balanced chemical equation for the reaction is: 2H₂ + O₂ → 2H₂O

b) Calculating the number of moles of the reactants needed to obtain 45 liters of H₂O:

From the balanced equation, we can see that for every 2 moles of H₂O produced, we need 2 moles of H₂ and 1 mole of O₂. Since the stoichiometry is based on moles, we need to convert the given volume of H2O into moles.

To convert volume to moles, we need to use the ideal gas law, PV = nRT. At standard temperature and pressure (STP), the molar volume of an ideal gas is 22.4 liters.

Given that we have 45 liters of H2O, we can calculate the number of moles as follows:

moles of H₂O = (volume of H₂O) / (molar volume at STP)

            = 45 liters / 22.4 liters/mol

            ≈ 2.008 moles of H₂O

Since the stoichiometry of the reaction is 2 moles of H₂O for every 2 moles of H₂, we need an equal number of moles of H₂. Therefore, the number of moles of H₂ required is also approximately 2.008 moles.

For O₂, since the stoichiometry is 1 mole of O₂ for every 2 moles of H₂O, we need half the number of moles of H₂O. Thus, the number of moles of O₂required is approximately 1.004 moles.

c)  the volume of the reactants:

Since the stoichiometry of the balanced equation is 2 moles of H₂for every 1 mole of O₂ and 2 moles of H₂O, we can deduce the volume of the reactants based on their molar volumes at STP.

For 2.008 moles of H₂, the volume can be calculated as follows:

volume of H₂= (moles of H₂) * (molar volume at STP)

            = 2.008 moles * 22.4 liters/mol

            ≈ 45 liters of H₂

For 1.004 moles of O₂, the volume can be calculated similarly:

volume of O₂= (moles of O₂) * (molar volume at STP)

            = 1.004 moles * 22.4 liters/mol

            ≈ 22.5 liters of O₂

Therefore, approximately 45 liters of H₂and 22.5 liters of O₂ are needed to obtain 45 liters of H₂O

for more questions on chemical
https://brainly.com/question/29886197
#SPJ8

The data collected by Leah and Paul supports Paul's opinion that matter can exist even when it is not visible.

Support is a term used to describe a range of services and resources offered to individuals in need. It can refer to providing help with practical tasks, such as helping someone to manage their finances or providing transport to medical appointments. It can also refer to providing emotional or social support. This could involve providing counselling or having regular conversations to help someone to feel understood and supported. Support can also refer to offering advice and guidance, or providing a safe space for someone to talk and express their feelings. In its broadest sense, support is about helping someone to have the best quality of life they can.

This is because the mass of the inflated bag is greater than the mass of the empty bag despite the fact that the volume of the inflated bag is much greater. This shows that the inflated bag contains air, which is matter, even though it cannot be seen.

To learn more about support
https://brainly.com/question/23849325
#SPJ1

To solve this problem, we can use the combined gas law, which states that the ratio of initial pressure, volume, and temperature is equal to the ratio of final pressure, volume, and temperature. The formula is as follows:

(P₁ * V₁) / T₁ = (P₂ * V₂) / T₂

Given:

Initial volume (V₁) = 447 mL

Initial temperature (T₁) = 106 ºC

Final volume (V₂) = 227 mL

We need to find the final temperature (T₂). Let's assume the initial and final pressures are constant, so we can ignore them.

Now, we can plug in the values into the formula:

(447 mL * T₂) / (106 ºC) = (227 mL * T₁) / (106 ºC)

Simplifying the equation:

447 mL * T₂ = 227 mL * 106 ºC

T₂ = (227 mL * 106 ºC) / 447 mL

T₂ ≈ 54 ºC

Therefore, the final temperature of the gas is approximately 54 ºC.

Learn more about combined gas law, here:

https://brainly.com/question/30458409

#SPJ1