Help please! What part of the model represents "n" in the
equation?

Help Please! What Part Of The Model Represents "n" In Theequation?

Answers

Answer 1
The answer is the ball

Related Questions

The Atlantic Ocean region contains approximately 2 × 10^16 gallons of water. Lake Ontario has approximately 8,000,000,000,000 gallons of water. How many Lake Ontarios would it take to fill the Atlantic Ocean region in terms of gallons of water?

Answers

Answer:

2500 gallons or water.

Step-by-step explanation:

Atlantic ocean contains 2 x 10¹⁶ gallons of water.

lake Ontario has approx 8 x 10¹² gallons of water.

req'd:

how many lake ontarios would it take to fill the Atlantic ocean in gallons of water?

= 2 x 10¹⁶ gallons of water

  8 x 10¹² gallons of water

= 2500 Lake Ontarios to fill The Atlantic Ocean

2500 times the gallons of water Lake Ontarios will take to fill the Atlantic Ocean region.


Given that,
The Atlantic Ocean region contains approximately 2 × 10^16 gallons of water.
Lake Ontario has approximately 8,000,000,000,000 gallons of water or 8 * 10¹².
To determine how many Lake Ontarios would it take to fill the Atlantic Ocean region in terms of gallons of water

What is the Ratio?

The ratio can be defined as the proportion of the fraction of one quantity towards others. e.g.- water in milk.

Here,
Lake Ontarios would it take to fill the Atlantic Ocean region
= 2 × 10¹⁶ / 8 * 10¹²
= 0.25 * 10⁴
= 2500 times the  gallons of water Lake Ontarios

Thus, 2500 times the gallons of water Lake Ontarios will take to fill the Atlantic Ocean region.

Learn more about ratios here:

brainly.com/question/13419413

#SPJ2


Determine whether each of these statements is true or false.a) 0 ∈ ∅ b) ∅∈{0}c) {0}⊂∅ d) ∅⊂{0}e) {0}∈{0} f ) {0}⊂{0}g) {∅} ⊆ {∅}

Answers

a) True, b) False, c) False, d) True, e) False, f) False, g) True

a) The statement is true. The symbol "∅" represents the empty set, which does not contain any elements. Since 0 is not an element of the empty set, the statement "0 ∈ ∅" is false.

b) The statement is false. The symbol "{0}" represents a set containing the element 0. The empty set, represented by "∅", does not contain any elements. Therefore, the empty set is not an element of the set {0}.

c) The statement is false. The symbol "{0}" represents a set containing the element 0. However, the empty set, represented by "∅", does not contain any elements. Therefore, the set {0} is not a subset of the empty set.

d) The statement is true. The empty set, represented by "∅", does not contain any elements. Every set is a subset of the empty set, including the set {0}.

e) The statement is false. The symbol "{0}" represents a set containing the element 0. In this case, {0} is not an element of itself. Therefore, the statement "{0}∈{0}" is false.

f) The statement is false. The symbol "{0}" represents a set containing the element 0. In this case, {0} is not a proper subset of itself. Therefore, the statement "{0}⊂{0}" is false.

g) The statement is true. The symbol "{∅}" represents a set containing the empty set. In this case, {∅} is a subset of itself because it contains the element ∅. Therefore, the statement "{∅} ⊆ {∅}" is true.

Learn more about empty set here: https://brainly.com/question/13553546

#SPJ11

Triangle x y z is reflected over its hypotenuse to form kite x y z y prime. hypotenuse x z has a length of 13, x y is 5, and y z is 12. triangle xyz is reflected over its hypotenuse to create a kite. what is the approximate distance from y to y’? round to the nearest tenth. 4.6 units 5.4 units 8.0 units 9.2 units

Answers

The approximate distance from y to y’ in the given triangle x y z reflected over its hypotenuse to form kite x y z y is  9.2 units.

Value of angle X

The value of angle X in ΔXYZ is calculated as follows;

tanx = 12/5

tanx = 2.4

x = tan⁻¹(.24)

x = 67.38⁰

Vertical height

The height from vertex Y to horizontal line XZ is calculated as follows;

sinx = h/5

h = 5(sinx)

h = 5(sin67.38)

h = 4.62

Distance between Y and Y'

YY' = 4.62 + 4.62 = 9.24 units

Learn more about kites here: https://brainly.com/question/23279609

#SPJ4

Answer:

A ✔️

Step-by-step explanation:

"4.6"

A quantity with an initial value of 120 decays exponentially at a rate of 9.5% every 7
hours. What is the value of the quantity after 3.25 days, to the nearest hundredth?

Answers

Answer:

39.46

Step-by-step explanation:

The null hypothesis refers to the ______, whereas the research hypothesis refers to the ______. Group of answer choices sample; population population; sample direction; sample population; direction Flag question: Question 6

Answers

The null hypothesis refers to the population, whereas the research hypothesis refers to the sample.

We have,

In statistics, the null hypothesis is a statement that assumes there is no significant difference between two groups or variables being compared.

It represents the default position that there is no relationship or effect between the variables of interest.

The null hypothesis is typically formulated as a statement about the population parameter.

On the other hand, the research hypothesis (also known as the alternative hypothesis) is a statement that proposes a significant difference or relationship between the variables being studied.

The research hypothesis is typically formulated as a statement about the sample, which is a subset of the population.

Thus,

The null hypothesis refers to the population, whereas the research hypothesis refers to the sample.

Learn more about null and research hypothesis here:

https://brainly.com/question/31525353

#SPJ1

Which set of ordered pairs does not represent a function?
O{(-2,5), (0, -9), (8,-2), (7,4)}
O{(-3,4), (-5,4), (7, -3), (2, -9)}
O {(2, -9), (-5, -1), (-6, -3), (-5,7)}
O {(1, -8), (-9,-2), (-4,0), (4, -8)}

Answers

Step-by-step explanation:

{(2, -9), (-5, -1), (-6, -3), (-5,7)}

-5 appears twice ( this is not allowed for the function)

Move numbers and symbols to the lines to create an expression that represents "the product of 7 and the quotient of 12 and b."
7
12
b

Answers

An expression that represents the given phrase is 7/12b.

The given phrase "the product of 7 and the quotient of 12 and b."

What is an expression?

An expression is a combination of terms that are combined by using mathematical operations such as subtraction, addition, multiplication, and division.

Here, the product of 7 and the quotient of 12 and b

7/(12×b)

= 7/12b

Hence, an expression that represents the given phrase is 7/12b.

To learn more about an expression visit;

https://brainly.com/question/28170201.

#SPJ1

Tutorial
An isosceles triangle has an angle that measures 100°. What measures are possible for the
other two angles? Choose all that apply.
80 100 40 50

Answers

The only measure that is possible for the other two angles is 40 degrees.

What is triangle ?

Triangle can be defined in which it consists of three sides, three angles and sum of three angles is always 180 degrees.

Let's call the two other angles in the isosceles triangle "x". We know that the sum of the three angles in a triangle is always 180 degrees. Therefore, we can set up an equation:

100 + x + x = 180

Simplifying this equation, we get:

2x + 100 = 180

Subtracting 100 from both sides, we get:

2x = 80

Dividing both sides by 2, we get:

x = 40

So the other two angles must both measure 40 degrees.

None of the other choices (80, 100, or 50 degrees) are possible for the other two angles in an isosceles triangle with one angle measuring 100 degrees.

Therefore, the only measure that is possible for the other two angles is 40 degrees.

To learn more about Triangle from given link.

https://brainly.com/question/2773823

#SPJ1

In one hour, a bakery sold 5 muffins and 9 bagels for total of $25. 50. The next hour, the bakery sold 3 muffins and 12 bagels for a total of $28. 50. Let m represent the price of one muffin and b represent the cost of one bagel. Draco wrote the following system of linear equations to solve for the cost of each item. 5 m 9 b = 28. 50. 3 m 12 b = 25. 50. What is Draco’s error? Draco should have set the first equation equal to 25. 50 and the second equation equal to 28. 50. Draco should have written the first equation as 3 m 9 b = 25. 50. Draco should have written 9b in the second equation and 12b in the first equation. Draco should have written the second equation as 5 m 12 b = 28. 50.

Answers

Answer:

Option A is the correct choice.

Step-by-step explanation:  

We have been given the system of linear equations written by Draco. We are asked to find Draco's error.

Let us form a system of equations using our given information.

Let m represent the price of one muffin and b represent the cost of one bagel.

We are told that in one hour a bakery sold five muffins and nine bagels for a total of $25.50. We can represent this information in an equation as:

The next hour the bakery sold three muffins and 12 bagels for a total of $28.50. We can represent this information in an equation as:

Now let us see system of equations written by Draco.

We can see that Draco has set the price of 5 muffins and 9 bagels equal to $28.50, which is the price of 3 muffins and 12 bagels.

Therefore, Draco should have set the first equation equal to 25.50 and the second equation equal to 28.50. The correct choice is option A.

Answer:

(A)Draco should have set the first equation equal to 25.50 and the second equation equal to 28.50.

Step-by-step explanation:

I did it on edge good luck

The top and bottom margins of a poster are each 3 cm and the side margins are each 2 cm. The area of printed material on the poster is fixed at 96 cm2. Find the dimensions of the printed area that minimize the area of the whole poster.

Answers

The dimensions of the smallest area of the poster is 8 cm by 12 cm.

Let the dimensions of the poster be x and y.

So, the area is:

Area =xy

The area is given as 96 cm²

So, we have:

A=(x-4)(y-6)

Make x the subject in xu=96

x=96/y

Substitute 96/y for x in

A = (x-4)(y-6)

A = (96/y - 4)(y - 6)

Express as:

A = (96y⁻¹ - 4)(y - 6)

Expand

A = 96 - 576y⁻¹ - 4y + 24

Differentiate

A' = 576y⁻² - 4

set to 0

576y⁻² - 4=0

Add 4 to both sides

576y⁻² = 4

Multiply both sides by y²

576 = 4y²

144 = y²

12 = y

Recall :

x = 96/y

x = 96/12

x = 8

Hence, the dimension of the smallest area of the poster is 8 cm by 12 cm

Read more about areas at:

brainly.com/question/11906003

#SPJ4

a manufacturer of potato chips would like to know whether its bag filling machine works correctly at the 411.0 gram setting. it is believed that the machine is underfilling the bags. a 35 bag sample had a mean of 406.0 grams. a level of significance of 0.05 will be used. state the hypotheses. assume the standard deviation is known to be 25.0.

Answers

Using a 35-bag sample with a mean of 406.0 grams, a known standard deviation of 25.0 grams, and a level of significance of 0.05, you can perform a one-tailed Z-test to determine whether to reject or fail to reject the null hypothesis.

To test if the potato chip manufacturer's bag filling machine is working correctly at the 411.0-gram setting, we will state the hypotheses using the given terms.

Null Hypothesis (H0): The machine fills bags correctly, with a mean weight of 411.0 grams (µ = 411.0 grams)
Alternative Hypothesis (H1): The machine is underfilling bags, with a mean weight less than 411.0 grams (µ < 411.0 grams)

To learn more about standard deviation, refer here:

https://brainly.com/question/23907081#

#SPJ11

Using an example, outline the steps involved in performing a
Wald test to test significance of a sub-group of coefficients in a
multiple regression model.

Answers

The Wald test is a statistical test that can be used to test the significance of a group of coefficients in a multiple regression model.

The test statistic is calculated as the ratio of the estimated coefficient to its standard error. If the test statistic is significant, then the null hypothesis that the coefficient is equal to zero can be rejected.

Suppose we have a multiple regression model with three independent variables: age, gender, and education. We want to test the hypothesis that the coefficients for age and education are both equal to zero. The Wald test statistic would be calculated as follows:

Test statistic = (Estimated coefficient for age) / (Standard error of estimated coefficient for age) + (Estimated coefficient for education) / (Standard error of estimated coefficient for education)

If the test statistic is significant, then we can reject the null hypothesis that the coefficients for age and education are both equal to zero. This would mean that there is evidence that age and education are both associated with the dependent variable.

The Wald test is a powerful tool that can be used to test the significance of a group of coefficients in a multiple regression model. However, it is important to note that the test statistic is only valid if the assumptions of the multiple regression model are met. If the assumptions are not met, then the p-value of the Wald test may be inaccurate.

Here are some of the assumptions of the multiple regression model:

* The independent variables are independent of each other.

* The dependent variable is normally distributed.

* The errors are normally distributed.

* The errors have constant variance.

If any of these assumptions are not met, then the Wald test may not be accurate.

Learn more about multiple regression model here:

brainly.com/question/32816836

#SPJ11

Calculate the index of refraction nr of the indicated refractive medium given the following assumptions:

Calculate the index of refraction nr of the indicated refractive medium given the following assumptions:

Answers

Given:

\(\begin{gathered} n_i=1.00 \\ \theta_i=60\degree \\ \theta_r=18.5\degree \end{gathered}\)

Required:

To find the value of nr.

Explanation:

The Snell's law is

\(\begin{gathered} n_i\sin\theta_i=n_r\sin\theta_r \\ \\ n_r=\frac{n_i\sin\theta i}{\sin\theta_r} \\ \\ =\frac{1.00\times\sin60}{\sin18.5} \\ \\ =\frac{1\times0.8660}{0.3173} \\ \\ =2.7292 \\ \\ n_r=2.73 \end{gathered}\)

explicit salem sets in r^n: an application of algebraic number theory to euclidean harmonic analysis

Answers

the study of explicit Salem sets in ℝⁿ is a rich and interdisciplinary area of research that combines ideas from algebraic number theory and Euclidean harmonic analysis to explore the connections between algebraic properties of numbers and the behavior of harmonic functions in Euclidean space.

Explicit Salem sets in ℝⁿ refer to sets of points in n-dimensional Euclidean space that satisfy certain properties related to algebraic number theory and harmonic analysis.

In algebraic number theory, Salem sets are named after Raphaël Salem, who studied them extensively in the mid-20th century. They are sets of points in ℝⁿ that possess specific arithmetic properties, particularly related to the distribution of algebraic numbers.

Harmonic analysis is a branch of mathematics that studies the properties and behavior of functions in terms of their frequency components. In Euclidean harmonic analysis, the focus is on analyzing functions in Euclidean spaces, such as ℝⁿ, using techniques from Fourier analysis and related areas.

The application of algebraic number theory to Euclidean harmonic analysis involves investigating the relationship between the distribution of algebraic numbers and the behavior of harmonic functions. Specifically, in the context of Salem sets, the properties of the set and its interaction with harmonic analysis techniques are studied.

Explicit Salem sets are sets in ℝⁿ that can be explicitly described or constructed and have specific algebraic number-theoretic properties that make them interesting in the context of Euclidean harmonic analysis. These sets often exhibit remarkable geometric and arithmetic structures, and their study can provide insights into various areas of mathematics, including number theory, geometry, and harmonic analysis.

Overall, the study of explicit Salem sets in ℝⁿ is a rich and interdisciplinary area of research that combines ideas from algebraic number theory and Euclidean harmonic analysis to explore the connections between algebraic properties of numbers and the behavior of harmonic functions in Euclidean space.

Learn more about Euclidean harmonic analysis here

brainly.com/question/32731179

#SPJ4

What is the answer to 108cm2= x^(x-3)

Answers

Answer: 22.5 and -19.5

Step-by-step explanation:

vector ⃗ has a magnitude of 13.1 and its direction is 50∘ counter‑clockwise from the - axis. what are the - and - components of the vector?

Answers

The x-component of the vector ⃗ is -9.98 and the y-component is 8.53.

We can find the x and y components of the vector ⃗ by using trigonometry. The magnitude of the vector is given as 13.1, and the direction of the vector is 50∘ counter-clockwise from the -axis. We can use the cosine and sine functions to find the x and y components, respectively.

cos(50∘) = -0.6428, sin(50∘) = 0.7660

x-component = magnitude x cos(50∘) = 13.1 x (-0.6428) = -9.98

y-component = magnitude x sin(50∘) = 13.1 x (0.7660) = 8.53

Therefore, the x-component of the vector ⃗ is -9.98, and the y-component is 8.53.

Learn more about vector here

https://brainly.com/question/25705666

#SPJ11

The x-component of the vector is approximately 8.375 and the y-component is approximately 9.955.

To find the x- and y-components of the vector, we can use trigonometry.

Given that the magnitude of the vector is 13.1 and the direction is 50° counter-clockwise from the - axis, we can determine the x- and y-components as follows:

The x-component (horizontal component) can be found using the formula:

x = magnitude * cos(angle)

x = 13.1 * cos(50°)

x ≈ 8.375

The y-component (vertical component) can be found using the formula:

y = magnitude * sin(angle)

y = 13.1 * sin(50°)

y ≈ 9.955

Know more about vector here:

https://brainly.com/question/29740341

#SPJ11

Convert the into millimetres.
A. 234cm
B. 15m
C. 25km

Answers

A. 234 cm

multiply the given length value ( 234 ) by 10.

\(234 \times 10\)

\( = 2340 \: mm\)

B. 15m

multiply the given length value ( 15 ) by 1000.

\(15 \times 1000\)

\( = 15000 \: mm\)

C. 25km

multiply the length value ( 25 ) by 1000000.

\(25 \times 1000000\)

\( = 25000000 \: mm\)

a)

234 × 10

= 2340 millimeters

b)

15 × 1000

= 15000 millimeters

c)

25 × 1000000

= 25000000 millimeters

Determine the slope of the line that passes through the points M(–3, 5) and N(1, 8). Represent the slope in decimal form.
Can someone please help me outt..

Answers

The slope should be 3/4. The whole equation simplified should be y= 3/4x+3.25

Plz answer

3x+5x=32. ​

Answers

X should equal 4 I’m sorry if I’m wrong have a good day/night !

Step-by-step explanation:

start by adding like terms which would gice us

3x+5x=8x so,

8x=32 divide by 8 on both sides so we leave x by itself giving us x=4

You own a farm and have several fields in which your livestock grazes. You need to order barbed-wire fencing for a small pasture that has a length of 5 yards and a width of 3 yards. The barbed wire must be long enough to be placed on all four sides of the outside pasture. How many yards of barbed-wire should you order?

Answers

Answer:

16 yards of barbed wire

Step-by-step explanation:

Length=5 yards

Width=3 yards

Perimeter of the pasture=2(length + width)

=2(5 yards +3 yards)

=2(8 yards)

=16 yards

You should order 16 yards of barbed wire for fencing the pasture

A theater production charges $21 for adult tickets and $15 for student tickets. If the
production sold 102 tickets for its opening night and made $1,932 in ticket sales, how
many of each type of tickets were sold?

Answers

Answer:

The number of adult tickets sold was 67, and the number of student tickets sold was 35.

Step-by-step explanation:

Hey! If you can help here it is!

Hey! If you can help here it is!

Answers

Answer:

\(x=3,x=-1\)

Step-by-step explanation:

Start with:

\(x(x-1)-3(x-3)+3(x-2)=x+6\)

Distribute the values on the outside of each of the parentheses.

\(x^2-x-3x+9+3x-6=x+6\)

Combine like terms.

\(x^2-x+3=x+6\)

Subtract \(6\) from both sides of the equation.

\(x^2-x-3=x\)

Subtract \(x\) from both sides of the equation.

\(x^2-2x-3=0\)

Now, we need to use our quadratic equation formula:

\(ax^2+bx+c=0\)

\(x= \frac{-b+/-\sqrt{b^2-4ac}}{2a}\)

Identify your values.

\(a=1\\b=-2\\c=-3\)

Substitute.

(Solve positive)

\(x= \frac{-(-2)+\sqrt{(-2)^2-4(1)(-3)}}{2(1)}\)

Solve.

\(x= \frac{2+\sqrt{(16}}{2}\)

Find the square root of \(16\).

\(x=\frac{2+4}{2}\)

Add.

\(x=\frac{6}{2}\)

Simplify.

\(x=3\)

~

(Solve negative)

\(x= \frac{-(-2)-\sqrt{(-2)^2-4(1)(-3)}}{2(1)}\)

Solve.

\(x= \frac{2-\sqrt{(16}}{2}\)

Find the square root of \(16\).

\(x=\frac{2-4}{2}\)

Subtract.

\(x=\frac{-2}{2}\)

Simplify.

\(x=-1\)

Write the following expression in terms of logs of x,y and z

Show steps

Answers

The expression in terms of logs of x, y, and z is: 2log(x) + log(y) - 3log(z).

Given an expression involving x, y, and z, we can write it in terms of logarithms using the properties of logarithms. Let the expression be (x^a * y^b) / z^c. To express this in terms of logs of x, y, and z, follow these steps:

The expression is (x^2 * y) / z^3.
We can express this in terms of logs as:
log(x^2 * y / z^3) = log(x^2) + log(y) - log(z^3)
= 2log(x) + log(y) - 3log(z).


Therefore, the expression in terms of logs of x, y, and z is:
2log(x) + log(y) - 3log(z).

follow these steps:

Step 1: Apply log to both sides:
log((x^a * y^b) / z^c) = log(x^a) + log(y^b) - log(z^c)

Step 2: Use the power rule of logarithms, which states log(m^n) = n * log(m):
a * log(x) + b * log(y) - c * log(z)

To know about log visit:

https://brainly.com/question/15673235

#SPJ11

8. Find the factors of sum of the smallest prime number and the smallest composite number.​

Answers

Answer:

6

Step-by-step explanation:

The smallest prime number is 2 and the smallest composite number is 4. And so, the sum of both of them is 2+4=6.


In the city of Carmen, there is a drawbridge that is opened twice per hour over the summer. The graph below shows the number of feet that the top of the bridge was above the water versus the amount of minutes that the
drawbridge was open

In the city of Carmen, there is a drawbridge that is opened twice per hour over the summer. The graph

Answers

Answer:

1) Between 0 and 1 minute the rate of change is 25 ft./min

2) Between 1 and 2 minute the rate of change is 0 ft./min

3) Between 2 and 4 minute the rate of change is -12.5 ft./min

Step-by-step explanation:

1) Between 0, and 1 feet, we have;

The rate of change = (Final height - Initial height)/(Final time - Initial time)

The rate of change = (40 - 15)/(1 - 0) = 25 ft/min

Between 0 and 1 minute the rate of change = 25 ft./min

2) Between 1, and 2 feet, we have;

The rate of change = (40 - 40)/(2 - 1) = 0 ft/min

Between 1 and 2 minute the rate of change = 0 ft./min

3) Between 2, and 4 feet, we have;

The rate of change = (15 - 40)/(4 - 2) = -12.5 ft/min

Between 2 and 4 minute the rate of change = -12.5 ft./min

Use an Addition or Subtraction Formula to write the expression as a trigonometric function of one number. cos 13π 15 cos − π 5 − sin 13π 15 sin − π 5 Find its exact value.

Answers

As per the addition formula, the value of the trigonometric function is -0.809.

In statistics, function is defined as a relationship between inputs where each input is related to exactly one output.

Here we have to find the value of the trigonometric function cos(13/15)cos(-/5)-sin(13/15)sin(-/5)  by using the addition and subtraction formula.

Here we have the following trigonometric function:

=> cos(13/15)cos(-/5)-sin(13/15)sin(-/5)

Now, we have to use the trigonometric addition formula,

=> Cos (A+B) = Cos A Cos B - Sin A Sin B

To solve the given function,

Here let us rewrite the given function based on the addition formula, then we get,

=> Cos ( 13π/15 + (-π/5) )

=> Cos( 12π/5)

=> Cos(144°)

=> -0.809

To know more about function here.

https://brainly.com/question/10354322

#SPJ4

Plz help with these 3:)

Plz help with these 3:)

Answers

Answer: 1) 2

2) 7/10

3) -1/3

in a toy store, the ratio of action figures to teddy bears 6 to 2. if the store has 320 total toys, how many teddy bears are there in the store?

Answers

6:2
3:1
18:6
24:8
240:80

There are 80 teddy bears

Given f(n) = mn and g(n) = 2n for m >1
Indicate which is true:
a. f(n) = Theta(g(n))
b. f(n) = Omega(g(n))
c.g(n) = Big-O(f(n))
d. g(n) = little-omage(f(n)) e. g(n) = Big-O(g(n)) f.

Answers

For m >1 the true are f(n) = Omega(g(n),g(n) = Big-O(f(n)),g(n) = Big-O(g(n)) and g(n) = Big-O(g(n) + n).The options that are correct is b,c,e,f.

Let's analyze each option:

a. f(n) = Theta(g(n))

This option is not true because f(n) is not bounded both above and below by g(n). Theta notation requires both upper and lower bounds to hold.

b. f(n) = Omega(g(n))

This option is true because f(n) is bounded below by g(n). Omega notation only requires a lower bound to hold.

c. g(n) = Big-O(f(n))

This option is true because g(n) is bounded above by f(n). Big-O notation requires an upper bound to hold.

d. g(n) = little-omage(f(n))

This option is not true because little-omega notation requires a strictly smaller growth rate, and in this case, f(n) and g(n) have the same growth rate.

e. g(n) = Big-O(g(n))

This option is true because g(n) is bounded above by itself. Big-O notation can be used to describe the upper bound of a function in terms of itself.

f. g(n) = Big-O(g(n) + n)

This option is true because g(n) + n is an upper bound for g(n). Big-O notation allows for tighter upper bounds.

g. f(n) = little-o(f(n))

This option is not true because little-o notation requires a strictly smaller growth rate, and in this case, f(n) has the same growth rate as itself.

h. f(n) = little-o(g(n))

This option is not true because little-o notation requires a strictly smaller growth rate, and in this case, f(n) and g(n) have the same growth rate.

In summary, the true options are:

b. f(n) = Omega(g(n))

c. g(n) = Big-O(f(n))

e. g(n) = Big-O(g(n))

f. g(n) = Big-O(g(n) + n)

For more such questions on true,click on

https://brainly.com/question/30414310

#SPJ8

The probable question may be:
Given f(n) = mn and g(n) = 2n for m >1

Indicate which is true:

a. f(n) = Theta(g(n))

b. f(n) = Omega(g(n))

c.g(n) = Big-O(f(n))

d. g(n) = little-omage(f(n))

e. g(n) = Big-O(g(n))

f. g(n) = Big-O(g(n) + n)

g. f(n) = little-o(f(n))

h. f(n) = little-o(g(n))

-5y+3x=3, -8y+9x=-12​

Answers

Answer:

x = -4

y = -3

Step-by-step explanation:

-5y + 3x = 3

-8y + 9x = -12​

Time the first equation by -3

15y - 9x = -9

-8y + 9x = -12

7y = -21

y = -3

Now put -3 in for y and solve for x

-5(-3) + 3x = 3

15 + 3x = 3

3x = -12

x = -4

Let's Check

-5(-3) + 3(-4) = 3

15 - 12 = 3

3 = 3

So, x = -4 and y = -3 is the correct answer.

Other Questions
Alina is organizing her research about journalist who cover the 1871 Chicago fire one of her sources is the great fire by Jim Murphy. which detail belongs in the actions area of this web? Economies of countries with dictatorships do not have healthy financial systems mainly because they lack what? why was trouble brewing along the pacific ocean, and for whom? why do you think the narrative begins with this announcement? cite evidence from the text. What are your thoughts on the fact that defendants can engage in bargaining, more frequently initiated by the prosecutor? Solve for the indicated variable. A = LW, solve for W there are 28 girls and 42 boys from 6 sections registered to participate in a science quiz bee. the quiz master divided the participants into teams with the same number of boys and girls on each team. how many teams will be there? how many boys and girls are on each team? Which excerpt reflects a second-person point of view?A. After he had dried his face and not knowing what else to do dried it again, the boy turned around, wondering what next. The door was open. He could make a dash for it down the hall. He could run, run, run, run, run! (Langston Hughes, Thank You Maam)B. Always obey your parents, when they are present. This is the best policy in the long run, because if you dont, they will make you. (Mark Twain, Advice to Youth)C. They stopped running and stood in the great jungle that covered Venus that grew and never stopped growing, tumultuously, even as you watched it. (Ray Bradbury, All Summer in a Day)D. The children lay out, laughing, on the jungle mattress, and heard it sigh and squeak under them resilient and alive. (Ray Bradbury, All Summer in a Day)E. "In my time," said the grandmother, folding her thin veined fingers, "children were more respectful of their native states and their parents and everything else." (Flannery OConnor, A Good Man Is Hard to Find) Which of the following shows a valid combustion reaction?2Al + 2O2 2AlO + O2C2H4 + 3O2 2CO2 + 2H2O2CH4 + O2 2CO + 4H2Ca + O2 CaOH Where did the plague originate Write the equation of the line in point-slope form with a slope of 5/2 and passing through the point (0,1). Someone plz help me :( For the boost converter with a nonideal inductor, produce a family of curves of Vo/Vs similar to figure below for rL/R 0.1, 0.3, 0.5, and 0.7. In both direct flooding attacks and ______ the use of spoofed source addresses results in response packets being scattered across the Internet and thus detectable.- ICMP attacks- indirect flooding attacks- SYN spoofing attacks- system address spoofingSYN spoofing attacks An internet service provider (ISP) has experienced rapid growth in the past five years. As part of its marketing strategy, the company promises fast connections dependable service. To achieve its objectives, the company constantly evaluates the capacity of its servers. One component of its evaluation is an analysis of the average amount of time a customer is connected and actively using the Internet daily. A random sample of 12 customer records shows the following daily usage times, in minutes.274 347 283 307 327 314303 285 280 391 359 325Interpret the confidence interval estimate.a. Based on the sample data, with 90% confidence, the ISP can conclude that the sample mean daily usage time is between _____ minute(s) and _____ minute(s).b. Based on the sample data, with 90% confidence, the ISP can conclude that the true population mean daily usage time is between _____ minute(s) and _____ minute(s).c. Based on the sample data, the ISP can conclude that 90% of daily usage times are between _____ minute(s) and _____ minute(s). lin is booting up his computer. sometimes during the boot process, the computer will shut down, but more often than not it will reboot on its own or simply freeze. he thinks the problem could be due to an intermittent undervoltage problem with the power supply, so he uses a power supply tester. the test shows that the power supply is functioning properly. what should lin check next in the troubleshooting process? A stone is dropped from a certain height and penetrates into mud. All else being equal, if it is dropped from twice the height, how much farther should it penetrate mud? trate 1. Farther than before, but less than twice as far 2. More than twice as far 3. Twice as far 4. Approximately as far The Happy Man by Naguib Mahfouz uses repetition 6. What changes in physical properties do you expect to see in your biopolymer if more borax is added to the synthesis Check My Work eBook Problem 14-01 Big Oil, Inc. has a preferred stock outstanding that pays a $6 annual dividend. If investors' required rate of return is 10 percent, what is the market value of the shares? Round your answer to the nearest cent. $ If the required return declines to 8 percent, what is the change in the price of the stock? Round your answer to the nearest cent. The price -Select- by s Check My Work 6 yd8 ydC=?Whats the hypotenuse?