How many moles of ions are contained in 1.27 L of a 1.75 M solution of Mg(NO3)2? Please answer in mol and round to the second decimal place.

The molarity of the solution if 3.2 moles of MgCl, are dissolved in 1.3 liters of water is 2.46 M.

The molarity of a solution is the concentration of a substance in solution, expressed as the number of moles of solute per litre of solution.

The molarity of a solution can be calculated by dividing the number of moles in the substance by its volume as follows:

molarity = no of moles ÷ volume

According to this question, 3.2 moles of MgCl, are dissolved in 1.3 liters of water. The molarity is as follows:

Molarity = 3.2mol ÷ 1.3L

Molarity = 2.46 M

Learn more about molarity at: https://brainly.com/question/31545539

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

ions are deflected and the lighter the ions the more the deflection.

Placing magnetic field in the path of the ions cause them to move in a curved path.

Explanation:

This question is all about the way in which mass spectroscopy works. Mass spectroscopy Is one of the techniques in spectroscopy which is used in the identification of chemical compounds.

Mass spectroscopy works based on the principle of ionization. For a mass spectroscopy to start ionization must first occur that is to say this is the first step in the identification of compound in mass spectroscopy.

The following steps are involve in mass spectroscopy;

=> Ionization: the molecules of the sample are first ionized. The ions formed here are positive ions.

=> Acceleration: the ions in step one are accelerated.

=> Deflection: the smaller ions get deflected more than the bigger ions. The magnetic field is used in the deflection of this ions.

=> Detection: the ions are then detected.

Therefore, to answer the question, the ions are deflected and the lighter the ions the more the deflection.

Placing magnetic field in the path of the ions cause them to move in a curved path.

The empirical formula of the compound is C₂H₁₆S₂N₃O.

The moles of each element is as follows::

For CO₂:

Carbon (C) has a molar mass of 12.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of C in CO₂ = 2.08 g / 12.01 g/mol = 0.173 moles

Moles of O in CO₂ = 2.08 g / 16.00 g/mol = 0.130 moles

For H₂O:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in H₂O = 1.28 g / 1.01 g/mol = 1.27 moles

Moles of O in H₂O = 1.28 g / 16.00 g/mol = 0.080 moles

For SO₃:

Sulfur (S) has a molar mass of 32.06 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of S in SO₃ = 4.77 g / 32.06 g/mol = 0.149 moles

Moles of O in SO₃ = 4.77 g / 16.00 g/mol = 0.298 moles

For HNO₃:

Hydrogen (H) has a molar mass of 1.01 g/mol.

Nitrogen (N) has a molar mass of 14.01 g/mol.

Oxygen (O) has a molar mass of 16.00 g/mol.

Moles of H in HNO₃ = 3.48 g / 1.01 g/mol = 3.45 moles

Moles of N in HNO₃ = 3.48 g / 14.01 g/mol = 0.248 moles

Moles of O in HNO₃ = 3.48 g / 16.00 g/mol = 0.217 moles

The simplest whole-number ratio of the elements will be:

Carbon: 0.173 moles / 0.080 moles ≈ 2.16

Hydrogen: 1.27 moles / 0.080 moles ≈ 15.88

Sulfur: 0.149 moles / 0.080 moles ≈ 1.86

Nitrogen: 0.248 moles / 0.080 moles ≈ 3.10

Oxygen: 0.080 moles / 0.080 moles = 1

Therefore, the empirical formula is C₂H₁₆S₂N₃O.

Learn more about empirical formulas at: https://brainly.com/question/1603500

#SPJ1

Answer:

An acid is any hydrogen-containing substance that is capable of donating a proton (hydrogen ion) to another substance. A base is a molecule or ion able to accept a hydrogen ion from an acid.

Answer:

1.Sour in taste

2. Tum blue litmus into red

3. Acids change methyl orange to red

4.Phenolphthalein remains colourless

5. Acids do not give soapy touch

6. Give hydrogen ions in solution

Bitter in taste

Answer:

Density of the oil is lesser than that of the water

Explanation:

The density of water is given as 1.0g/cm³.

  Salad oil is found to float on water, this implies that the density of this salad oil is lesser than that of the water.

Density is the mass per unit volume of a substance.

Answer:   Analyzing

Explanation: because analyzing comes first you have to know what you are dealing with

The percent by mass of Lead in Lead (IV) oxide (\(PbO_2\)) is equal to 86.62%.

Scientific data:

To calculate the percent by mass of Lead in Lead (IV) oxide (\(PbO_2\)):

First of all, we would calculate the molar mass of Lead (IV) oxide (\(PbO_2\));

\(PbO_2 = 207.2 + 16(2)\\ \\ \)

Lead (IV) oxide (\(PbO_2\)) = 239.2 g/mol.

For the percent by mass of Lead, we would calculate it by using this formula:

\(P = \frac{Mass}{Mass\;of\;compound} \times 100\)

Substituting the parameters into the formula, we have;

\(P = \frac{207.2}{239.2} \times 100\\ \\ P=0.8662 \times 100\)

Percent mass of Lead = 86.62%

Read more on percent mass here: https://brainly.com/question/15182450

Answer:

the powerhouse of the cell

Explanation:The unit is -

o

I

I hope it helped you.

A Brainliest please.

ASK for more

The pH of the solutions are as follows:

a. pH = 4.4

b. pH = 0.2

The pH of a solution is a measure of the acidity or basicity of a solution.

The pH is defined as the negative logarithm of the hydrogen ion concentration of a substance.

pH = -log [H⁺]

where [H⁺] is the hydrogen ion concentration

The pH of the solutions are as follows:

a.  150.0 ml of a 3.5 x 10⁻⁵ M HNO3.

pH = -log (3.5 x 10⁻⁵)

pH = 4.4

b. 250.0 ml of a 0.63 M solution of HNO2

pH = -log (0.63)

pH = 0.2

Learn more about pH at: https://brainly.com/question/172153

#SPJ1

Answer:

0.4941, 0.5059

Explanation:

\(P_N\) = Partial pressure of nitrogen = 417 mm Hg

\(P_{Xe}\) = Partial pressure of xenon = 427 mm Hg

Total pressure in the system is given by

\(P=P_N+P_{Xe}\\\Rightarrow P=417+427=844\ \text{mm Hg}\)

Mole fraction is given by

\(X_N=\dfrac{P_N}{P}\\\Rightarrow X_N=\dfrac{417}{844}\\\Rightarrow X_{N}=0.4941\)

For xenon

\(X_{Xe}=1-0.4941=0.5059\)

or

\(X_{Xe}=\dfrac{P_{Xe}}{P}\\\Rightarrow X_{Xe}=\dfrac{427}{844}\\\Rightarrow X_{Xe}=0.5059\)

So, mole fraction of nitrogen is 0.4941 and xenon is 0.5059.

The specific equation depends on the isomer and the oxidizing agent used. An example of a general oxidation reaction could be:

C₃H₇OH + [O] → C₃H₆O + H₂O

Common oxidizing agents for organic compounds include potassium permanganate (KMnO₄), potassium dichromate (K₂Cr₂O₇), or hydrogen peroxide (H₂O₂).

Whether or not the product needs to be removed from the reaction vessel depends on the specific reaction and its desired outcome. In some cases, the product may be of interest for further reactions or analysis, and therefore, it would be retained in the reaction vessel.

Learn more about oxidation, here:

https://brainly.com/question/16976470

#SPJ1

Explanation:

Molar mass is the the mass of one mole of a substance and is expressed in g/mol. Gold atomic mass is 196.96657, chlorine has 35.453. Hence, molar mass of AuCl3= atomic number of Gold + atomic mass of chlorine × (number of atoms of chlorine in AuCl3). Molar mass of AuCl3 = 196.96657 + (35.453 × 3).

Complete Question

The complete question is shown on the first uploaded image  

Answer:

The density is  \(\rho = 21.1 \ g/cm^3\)

Explanation:

From the question we are told that

      The lattice constant is  \(a = 0.387 nm = 0.387 *10^{-9} \ m\)

Generally the volume of the unit cell is  \(V = a^3\)

                                                             =>   \(V = [0.387 *10^{-9}]^2\)

                                                                   \(V = 5.796 *10^{-29} \ m^3\)

Converting to  \(cm^3\)   We have  \(5.796 *10^{-29} * 1000000 = 5.796 *10^{-23} cm^3\)

The molar mass of Tungsten is constant with a value  \(Z = 184 g/mol\)

One mole of Tungsten contains  \(6.022*10^{23}\) unit cells

    Where \(6.022*10^{23}\)  is  a constant for the number of atom in one mole of a substance(Tungsten) which is known as Avogadro's constant

      Now for FCC distance  the number of atom per unit cell  is  n =  4

               Mass of Tungsten (M) =  \(= \frac{Z * n }{1 \ mole \ of \ Tungsten}\)

=>              Mass of Tungsten (M) =  \(= \frac{184 * 4 }{6.023*10^{23}}\)

=>              Mass of Tungsten (M) =  \(= 1.222*10^{-21} \ g\)

 Now  

      The density of  Tungsten is  

                  \(\rho = \frac{M}{V}\)

substituting values

                \(\rho = \frac{1.222*10^{-21}}{5.796*10^{-23}}\)

                \(\rho = 21.1 \ g/cm^3\)

Answer:

The answer is (400, 0.5)

Element w is less reactive than elements x, y, and z. The element with the lower atomic number is typically less reactive.

Element w has an atomic number of 9, element x has an atomic number of 10, element y has an atomic number of 11, and element z has an atomic number of 12. Based on this information, we can conclude that element w is less reactive than elements x, y, and z.

This is because the reactivity of an element is largely determined by the number of valence electrons it has. Valence electrons are the electrons in the outermost shell of an atom that are involved in chemical reactions. Elements with fewer valence electrons are less reactive because they are more stable. Element w has only one valence electron, while elements x, y, and z have two, three, and four valence electrons, respectively.

In general, elements with a full outermost shell of electrons, such as the noble gases, are the least reactive because they are highly stable. Elements that are close to having a full outermost shell, such as element w, are also relatively stable and less reactive. On the other hand, elements with only a few valence electrons, such as the alkali metals, are highly reactive because they are trying to gain or lose electrons in order to achieve a full outermost shell.

Overall, the reactivity of an element is determined by its electronic structure, with elements having fewer valence electrons generally being less reactive than those with more. In the case of the elements w, x, y, and z, we can see that element w has the fewest valence electrons and is therefore the least reactive.

For more such questions on Element

https://brainly.com/question/28376204

#SPJ11

The SI unit to the quantity it measures are:

Mass: The mass of an object is a measure of its amount of matter. The SI unit of mass is the kilogram (kg) or gram (g).

Temperature: Temperature is a measure of the average kinetic energy of the particles in a substance. The SI unit of temperature is the kelvin (K).

Time: Time is a measure of the interval between two events. The SI unit of time is the second (s).

Electric current: Electric current is a measure of the flow of electric charge. The SI unit of electric current is the ampere (A).

Find out more on SI unit here: https://brainly.com/question/16393390

#SPJ1

Complete question:

Drag the tiles to the correct boxes to complete the pairs. Not all tiles will be used.

Match each SI unit to the quantity it measures.

Answer:

0.579 moles

Explanation:

Moles = 23.53/40.64

= 0.5789 moles

Answer:

D produce energy

Explanation:

Mitochondria are membrane-bound cell organelles (mitochondrion, singular) that generate most of the chemical energy needed to power the cell's biochemical reactions.

Answer:produce energy

Explanation:

The molarity of the NiSO₄ solution made by dissolving 38.81 grams of nickel (ii) sulfate, NiSO₄, in enough water to make 0.467 liters of solution is 0.535 M

First, we shall obtain the mole of 38.81 grams of nickel (ii) sulfate, NiSO₄. Details below:

Mole of NiSO₄ = mass / molar mass

= 38.81 / 154.75

= 0.25 mole

Now, we shall determine the molarity of the solution. Details below:

Molarity of solution = mole / volume

= 0.25 / 0.467

= 0.535 M

Thus, the molarity of the solution is 0.535 M

Learn more about molarity:

https://brainly.com/question/16073358

#SPJ1

Answer:

\( This\:may\: help\)

Answer:

(1) Write down the chemical reaction in the form of word equation,keeping reactants on left hand side and products on right hand side.

(2) Write symbol and formula of all reactants and products in word equation. (3) Balance the equation by multiplying the symbols and formula by smallest possible figures.

Answer:

0.2 mole

Explanation:

From the question given above, the following data were obtained:

Number of molecules = 12.06×10²²

Number of mole =?

From Avogadro's hypothesis,

6.02×10²³ molecules = 1 mole

Therefore,

12.06×10²² molecules = 12.06×10²² / 6.02×10²³

12.06×10²² molecules = 0.2 mole

Thus, 12.06×10²² molecules is equivalent to 0.2 mole

The heat of solution for 10.5 g of potassium perchlorate dissolved in 113.8 mL of water is approximately -83.99 kJ/10.5 g.

The heat of solution is described as the enthalpy change associated with the dissolution of a substance in a solvent at constant pressure resulting in infinite dilution.

For 10.5 g of potassium perchlorate dissolved in 113.8 mL of water, the amount of heat released can be estimated as follows:

-599 kJ/mol x (10.5 g / 138.55 g/mol) = -44.31 kJ

-548 kJ/mol x (10.5 g / 138.55 g/mol) = -39.68 kJ

The heat of solution for potassium perchlorate will then be calculated as the sum of the lattice energy and heat of hydration which gives us that

Heat of solution = -44.31 kJ + -39.68 kJ = -83.99 kJ/10.5 g

Learn more about heat of solution  at: https://brainly.com/question/28169738

#SPJ1

Answer:

Mechanical Energy- Energy that result from movement or the location of the object. Is the sum of kinetic and potential energy.

Thermal Energy- Thermal energy or heat energy reflects the temperature difference between two systems.

Nuclear Energy-  is energy resulting from changes in the atomic nuclei or from nuclear reactions.

Chemical Energy- results from chemical reactions between atoms or molecules.

More:

Kinetic energy- is the energy of motion of a body. It ranges from 0 to a positive value.

Electromagnetic energy- (or radiant energy) is energy from light or electromagnetic waves.

Sonic energy-  is the energy of sound waves. Sound waves travel through the air or another medium.

Gravitational energy- energy associated with gravity involves the attraction between two objects based on their mass.

Ionization energy- is the form of energy that binds electrons to the nucleus of its atom, ion, or molecule.

Potential energy- is the energy of an object's position.

Explanation:

Hope this helps

1. The % concentration is 20.7% and the molar concentration, Cm, is 1.5 M.

2. 7.8 grams of potassium sulfate will be formed.

3. 10.7 grams of ammonium chloride will be formed.

4. The volume of hydrogen gas that will be produced is 3.86 liters.

5. 21.43 grams of the 70% acetic acid is needed to prepare 500 grams of 3% acetic acid solution.

1. Mass of potassium sulfate = 1.5 moles * (174.26 g/mol) = 261.39 g

Mass of water (H₂O) = 1000 g

% = (mass of solute/mass of solution) x 100

% = (261.39 g / (261.39 g + 1000 g)) x 100

% ≈ 20.7%

Cm = moles of solute / volume of solution

Moles of potassium sulfate (K2SO4) = 1.5 moles

Volume of water (H2O) = 1000 g / (density of water) = 1000 g / 1 g/mL = 1000 mL = 1 L

Cm = 1.5 moles / 1 L

Cm = 1.5 M

2. The balanced equation for the reaction is:

H₂SO₄ + 2 KOH → K₂SO₄ + 2 H₂O

Molar mass of sulfuric acid (H₂SO₄) = 98.09 g/mol

Moles of sulfuric acid = 10 g / 98.09 g/mol

Moles of sulfuric acid = 0.102 mol

Based on the mole ratio of the reaction, 0.102 moles of sulfuric acid will react to form 0.102 moles of potassium sulfate.

Molar mass of potassium sulfate = 174.26 g/mol

Mass of potassium sulfate = 0.102 mol x 174.26 g/mol

Mass of potassium sulfate ≈ 17.8 g

3. The balanced equation for the reaction is:

Molar mass of hydrochloric acid (HCl) = 36.46 g/mol

Moles of hydrochloric acid (HCl) = 7.3 g / 36.46 g/mol

Moles of hydrochloric acid ≈ 0.2 mol

Based on the mole ratio of the reaction, 0.2 moles of hydrochloric acid will react to form 0.2 moles of ammonium chloride.

Molar mass of ammonium chloride (NH₄Cl) = 53.49 g/mol

Mass of ammonium chloride = 0.2 mol x 53.49 g/mol

Mass of ammonium chloride ≈ 10.7 g

4. The balanced equation for the reaction is:

Molar mass of zinc (Zn) = 65.38 g/mol

Moles of zinc = 13 g / 65.38 g/mol

Moles of zinc ≈ 0.199 mol

Based on the mole ratio of the reaction, 0.199 moles of zinc will react to produce 0.199 moles of hydrogen gas.

Volume of sulfuric acid = 30 g / (density of H₂SO₄ )

The density of H₂SO₄ is 1.84 g/mL

Volume of sulfuric acid  = 30 g / 1.84 g/mL

Volume of sulfuric acid ≈ 16.3 mL or 0.0163 L

Using the ideal gas law, the volume of hydrogen gas produced will be:

V = nRT / P

V = (0.199 mol)(0.0821 L·atm/(mol·K))(273 K) / (1 atm)

V ≈ 3.86 L

5. Assuming that the concentrated original solution of acetic acid is 100% acetic acid (CH₃COOH).

Mass of acetic acid = 500 g x (3/100) = 15 g

The concentrated original solution, however, is 70% acetic acid.

70% acetic acid (mass) = 100% acetic acid (unknown mass)

0.7 * (unknown mass) = 15 g

Solving for the unknown mass:

unknown mass = 15 g / 0.7

unknown mass ≈ 21.43 g

Learn more about percentage concentration at: https://brainly.com/question/18761928

#SPJ1

Answer:

The molar density of any ideal gas at STP is:

1 mol / 22.4 L = 0.04464 mol / L

The molar mass of F2 is: 2(19) = 38 g/mol

0.04464 mol / L * (38 g / mol) = 1.70 g/L

Explanation:

The arrow in a chemical reaction means

A chemical reaction is a procedure that causes one group of chemical components to change chemically into another. Chemical reactions, which can frequently be described by a chemical equation, traditionally include changes that only affect the locations of electrons in the formation and dissolution of chemical bonds between atoms, with no change to the nuclei.

At a specific temperature and chemical concentration, chemical reactions occur at a predictable reaction rate. Because there is more thermal energy available to attain the activation energy required to break bonds between atoms, reaction rates often increase as temperature rises.

The arrow in the reaction is telling us that what we have in the left hand side of the equation has resulted in the equation that we have on the right.

Learn more on chemical reaction here https://brainly.com/question/25769000

#SPJ1

Answer:

A and C

Explanation:

Got it right on the pretest