Observe the two scenarios involving electrically charged objects. Predict what will happen when you bring the objects close together. (2 points)

Two scenarios with electrically-charged objects. In the first scenario, a negatively charged balloon is brought close to a positively charged soda can. In the second scenario, a negatively charged balloon is brought close to a negatively charged balloon.

a
The balloon will attract the soda can, while the two balloons will repel each other.

b
The balloon will attract the soda can, while the two balloons will do nothing.

c
The balloon will repel the soda can, while the two balloons will also repel each other.

d
The balloon and soda can will do nothing, while the two balloons will repel each other.
a balloon with a minus and a soda with a plus a balloon with a minus and another balloon with a minus

Deleted answer. ......

North America and south africa

Answer:

C

Explanation:

Answer:

Silver phosphate or silver orthophosphate is a light sensitive, yellow, water-insoluble chemical compound composed of silver and phosphate ions of formula Ag3PO4.

Chemical formula: Ag3PO4

Molar mass: 418.574 g/mol

Solubility in water: 0.00065 g/100 mL

Crystal structure: cubic

Explanation:

Answer:

300

Explanation:

Answer:

One atom of sulfur has a mass of 32.07 AMU; one mole of S atoms has a mass of 32.07 g.

Explanation:

Therefore, the answer should be 32.07 g

Answer: single replacement reaction

Explanation:

A single replacement reaction is one in which a more reactive element displaces a less reactive element from its salt solution. Thus one element should be different from another element.

A general single displacement reaction can be represented as :

\(X+YZ\rightarrow XZ+Y\)

The reaction \(2AgNO_3(aq)+Zn(s)\rightarrow 2Ag(s)+Zn(NO_3)_2(aq)\)

When zinc metal is added to aqueous silver nitrate, zinc being more reactive than silver displaces silver atom from its salt solution and lead to formation of zinc nitrate and silver metal.

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:

Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

The molar mass of MgCl₂ is 95.21 g/mol.

First, we need to calculate the number of moles of MgCl₂ formed:

Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂

Moles of MgCl₂ = 34.52 g / 95.21 g/mol

Moles of MgCl₂ = 0.363 mol

According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:

Moles of HCl = 2 * Moles of MgCl₂

Moles of HCl = 2 * 0.363 mol

Moles of HCl = 0.726 mol

To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of molecules of HCl = Moles of HCl * Avogadro's number

Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol

Number of molecules of HCl = 4.37 x 10^23 molecules

Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

For more such questions on molecules

https://brainly.com/question/1351818

#SPJ8

This extremely high temperature indicates that under normal conditions, you do not need to worry about your car tire bursting from overheating as it is unlikely to reach such extreme temperatures.

To determine the temperature at which the tire will burst, we can use the ideal gas law equation:

PV = nRT

Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature in Kelvin.

Rearranging the equation to solve for temperature, we have:

T = PV / (nR)

Given that the pressure threshold for bursting is 1.4 x 10^3 kPa, the volume is 30 L, and the number of moles of air is 2.5 mol, we can substitute these values along with the ideal gas constant R = 8.314 J/(mol K) into the equation.

T = (1.4 x 10^3 kPa) * (30 L) / (2.5 mol * 8.314 J/(mol K))

Converting kPa to Pa and L to m^3, and simplifying the equation, we find:

T ≈ 20,993 K

This extremely high temperature indicates that under normal conditions, you do not need to worry about your car tire bursting from overheating as it is unlikely to reach such extreme temperatures.

For more question on temperatures

https://brainly.com/question/4735135

#SPJ8

Answer:

Explanation:

Figure 6. An instant cold pack consists of a bag containing solid ammonium nitrate and a second bag of water. When the bag of water is broken, the pack becomes cold because the dissolution of ammonium nitrate is an endothermic process that removes thermal energy from the water.

The molar mass when rected with sulphuric acid to liberate 249 mL of hydrogen gas is 48 g/mol

The volume (V) = 249 mL = 249 / 1000 = 0.249 L

Pressure (P) = 1.0079 – 0.03167 = 0.97623 bar

The temperature (T) = 25.0 °C = 25 + 273 = 298 K

Gas constant (R) = 8.314×10¯² bar.L/Kmol

Number of mole (n) =?

n = PV / RT

n = (0.97623 × 0.249) / (8.314×10¯² × 298)

n = 0.0098 mole

How to determine the mole of the metal

Balanced equation

M(s) + H₂SO₄(aq) —> MSO₄(aq) + H₂(g)

From the balanced equation above,

1 mole of M reacts to produce 1 mole of H₂.

Therefore,

Mole of metal = 0.0098 mole

Mass of metal = 0.539 g

Molar mass is given as mass upon mole

Molar mass of metal = 0.470 / 0.0098

Molar mass of metal = 48 g/mol

Learn more about stoichiometry at:

brainly.com/question/14735801

#SPJ9

Answer:

42.82 × 10²³ formula units

Explanation:

Given data:

Number of moles of CaCl₂ = 7.11 mol

Number of formula units = ?

Solution:

We will solve this problem by using Avogadro number.

1 mole of substance contain 6.022× 10²³ formula units.

7.11 mol × 6.022× 10²³ formula units / 1mol

42.82 × 10²³ formula units

Answer:

Like Roman said Avogadro's number is the key to your problem. The value that you'll use on paper is 6.022x10^23. Luckily in our case a mol specifically refers to the amount of atoms. Its a weird concept but 1.97 mol of Aluminum is the exact same amount of atoms as say helium. The only differences lay in the total mass of the sample.

Answer:

5.89×10^-7 meters

Explanation:

wavelength= speed of light/frequency

3.00×10^8m/s÷5.09×10^14s=5.89×10^-7 meters

The statement "All organic compounds contain the element carbon, but not all compounds containing the element 'carbon' are organic" can be justified based on the definition and characteristics of organic compounds.

Organic compounds are compounds primarily composed of carbon and hydrogen atoms, often with other elements like oxygen, nitrogen, sulfur, and phosphorus. These compounds are typically associated with living organisms and are known for their unique properties and behavior, including the ability to form complex structures, exhibit covalent bonding, and undergo organic reactions.

On the other hand, there are compounds that contain carbon but are not classified as organic. One notable example is carbon dioxide (\(CO_{2}\)), which is a simple inorganic compound composed of carbon and oxygen. Carbon dioxide does not possess the characteristic properties of organic compounds, such as the ability to form long chains or undergo organic reactions.

Additionally, there are inorganic compounds like carbonates (such as calcium carbonate) and carbides (such as calcium carbide) that contain carbon but are not considered organic. These compounds have distinct chemical and physical properties different from those of organic compounds.

In summary, while all organic compounds contain carbon, not all compounds containing carbon are organic. The classification of a compound as organic or inorganic depends on its overall molecular structure, bonding, and characteristic properties.

Know more about molecular structure here:

https://brainly.com/question/27789666

#SPJ8

The amount of the barium-131 that would remain after 2 months (i.e 60 days), given that the barium-131 has an half-life of 11.6 days is 0.014 g

We know that the half-life of a material is the time taken for half the material to decay.

Thus, given the half-life of the barium-131, we shall begin our calculation by obtaining the number of half lives that has passed. This is shown below:

n = t / t½

n = 60 / 11.6

Finally, we shall determine the amount that will remain after 2 months. This is illustrated below:

N = N₀ / 2ⁿ

N = 0.5 / 2^(60 / 11.6)

N = 0.014 g

In conclusion, we can say that the amount that would remain after 2 months is 0.014 g

Learn more about amount remaining:

https://brainly.com/question/28440920

#SPJ1

The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ

First, we shall obtain the limiting reactant. Details below:

3H₂ + N₂ -> 2NH₃

From the balanced equation above,

28 g of N₂ reacted with 6 g of H₂

Therefore,

2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂

We can see that only 0.43 g of H₂ is needed in the reaction.

Thus, the limiting reactant is N₂

Finally, we the amount of heat energy produced. Details below:

3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ

From the balanced equation above,

When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.

Therefore,

When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ

Thus the heat energy produced from the reaction is -6.61 KJ

Learn more about heat energy:

https://brainly.com/question/31429264

#SPJ1

Answer:

there are 1.4201927800478769 moles in 83 particles of sodium chloride. or 1.42 for short.

Explanation:

Answer:

301.15 K

Explanation:

Answer:

4 PH₃ + 8 O₂ -----> P₄O₁₀ + 6 H₂O

Explanation:

An equation is balanced when there is an equal amount of each element on both sides of a chemical reaction. Remember, the reactants are the molecules that lie on the left of the reaction arrow and the products are the molecules that lie on the right.

The unbalanced equation:

PH₃ + O₂ -----> P₄O₁₀ + H₂O

Reactants: 1 phosphorus, 3 hydrogen, 2 oxygen

Products: 4 phosphorus, 2 hydrogen, 11 oxygen

As you can see, there is an unequal amount of each element. To balance the equation, we can add coefficients to change the quantity of particular molecules. By doing this, you subsequently change the amount of the elements.

The balanced equation:

4 PH₃ + 8 O₂ -----> P₄O₁₀ + 6 H₂O

Reactants: 4 phosphorus, 12 hydrogen, 16 oxygen

Products: 4 phosphorus, 12 hydrogen, 16 oxygen

****P₄O₁₀ technically has a coefficient of 1

Answer:

A, Hail is large spheres of ice and snow is small flakes of ice.

The vapor pressure of the solution is approximately 118.64 torr.

To calculate the vapor pressure of a solution containing 495 mL of ethanol and 165 mL of pentane, we need to use the concept of partial pressures.

The mole fraction of ethanol in the solution can be calculated as follows:

X_ethanol = (495 mL * 0.785 g/mL) / (46.068 g/mol) / (495 mL + 165 mL)

= 0.496

The mole fraction of pentane in the solution can be calculated as follows:

X_pentane = (165 mL * 0.626 g/mL) / (72.151 g/mol) / (495 mL + 165 mL)

= 0.167

The vapor pressure of the solution can be calculated as the sum of the partial pressures of its components, which can be calculated as the product of their mole fraction and vapor pressure of the pure component:

P_vapor = X_ethanol * 93.0 torr + X_pentane * 435.0 torr

P_vapor = 46.688 torr + 71.955 torr

P_vapor = 118.64 torr

Learn more about vapor pressure:

https://brainly.com/question/2693029

#SPJ1

Answer:

A. The seeds on the ground are going to grow into new trees.

Explanation:

Trees are renewable resources.

The IUPAC name of the compound is 3-Ethyl-2,2-dimethylhexane.

IUPAC naming is a systematic method of naming chemical compounds according to a set of rules established by the International Union of Pure and Applied Chemistry. It ensures that each compound has a unique and unambiguous name based on its molecular structure.

From the image:

Thus, the IUPAC name of the compound is 3-Ethyl-2,2-dimethylhexane.

More on IUPAC naming can be found here: https://brainly.com/question/30086566

#SPJ1

Explanation:

Atomic number is the number of protons found in the element's atom. Since it has atomic number 43, we find the 43rd element in the Periodic table, which is Technetium. (Tc)

P.S. Mass number is the number of protons and neutrons in the element's atom

Answer:

Atomic number is the number of protons found in the element's atom. Since it has atomic number 43, we find the 43rd element in the Periodic table, which is Technetium. (Tc)

Explanation:

ChoiSungHyun

Credit