The decomposition of ethanol (C2H5OH) on an alumina (Al2O3) surface was studied at 600 K. Concentration versus time data were collected for this reaction, and a plot of [A] versus time resulted in a straight line with a slope of -4.00 10-5 mol/L · s.
C2H5OH(g) → C2H4(g) + H2O(g)
(b) If the initial concentration of C2H5OH was 1.10 10-2 M, calculate the half-life for this reaction.
(c) How much time is required for all the 1.10 10-2 M C2H5OH to decompose?

Answer:

The answer is

Plant also use cellular respiration

Answer:

B - Plants also use cellular respiration.

Explanation:

Did the test.

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

D

Explanation:

Answer:

False, False, True, True, False, True

Explanation:

true? no false.   ...   no its true uhhhhh no gotta be false true. false. true. fase. gotta be tru false or maybe its true? nah its false

pls brainliest?

Hey love! <3

Answer:

C. Resource use by humans has gone up and down over the years is a false statement

Explanation:

In the graph you can make an observation on how the increase of human population is directly positive.

The resource use either has a positive or negative correlation, making it impossible for the usage to fluctuate over the years.

Hope this brightens up your day a little! ❀‿❀ Sincerely, Kelsey from Brainly.

~ #LearnWithBrainly ~

There is no reaction between zinc II sulfate and magnesium sulfate.

We know that a reaction is said to occur when two species are combined and there are new products that appear in the system. This implies that if there are no new substances that appear in the system we can not say that a chemical reaction has taken place.

In this case, we can see that we can not be able to observe any change when wee mix a solution of magnesium sulfate and zinc II sulfate since the both of them have the same anion.

Learn more about reaction:https://brainly.com/question/28984750

#SPJ1

Answer:

In chemistry, a conjugated system is a system of connected p orbitals with delocalized electrons in a molecule, which in general lowers the overall energy of the molecule and increases stability. It is conventionally represented as having alternating single and multiple bonds. Lone pairs, radicals or carbenium ions may be part of the system, which may be cyclic, acyclic, linear or mixed. The term "conjugated" was coined in 1899 by the German chemist Johannes Thiele.[1]

Cinnamaldehyde is a naturally-occurring compound that has a conjugated system

penta-1,3-diene is a molecule with a conjugated system

Diazomethane conjugated pi-system

Answer:

protons are red neutrons are green electrons are yellow

Explanation:

TIE FIGHTERS GO ZOOOOOM

Answer:5000 i think

Explanation:

Answer:

23.1 x 10^11

Explanation:

(4.2x5.5) x (10^9x10^2)

23.1 x 10^11   (Add the exponents, and multiply the decimals.)

I hope this helped! :)

Answer:

O=C=O

Explanation:

PLATO ANSWER

In carbon dioxide (CO₂), bonding occurs through a combination of covalent and double covalent bonds between the carbon atom and the oxygen atoms.

Carbon dioxide is a linear molecule composed of one carbon (C) atom and two oxygen (O) atoms. Each oxygen atom shares a double bond with the central carbon atom, resulting in a stable molecular structure.

Covalent bonding involves the sharing of electrons between atoms to achieve a stable electron configuration. In the case of carbon dioxide, each oxygen atom shares four electrons with the carbon atom, and the carbon atom shares four electrons overall with the two oxygen atoms.

The image is attached below.

Learn more about carbon dioxide, here:

https://brainly.com/question/14581272

#SPJ4

Answer:

Explanation:

To calculate the molar internal energy of a gas at a given temperature, you need to know the molar specific heat capacities at constant volume and constant pressure for the gas. These values are typically provided in tables of thermodynamic data, which can be found in various sources such as textbooks or online. Since you mentioned that you want to take the translational and rotational degrees of freedom into consideration, you will need to use the molar specific heat capacity at constant volume, which accounts for these degrees of freedom.

Once you have the molar specific heat capacity at constant volume for the gas, you can use the equation U = Cv * T, where U is the molar internal energy, Cv is the molar specific heat capacity at constant volume, and T is the temperature in kelvins. In your case, the temperature is 298.15 K, so plugging in the appropriate values and solving for U will give you the molar internal energy of carbon dioxide at that temperature.

It's important to note that the molar specific heat capacity at constant volume is typically a function of temperature, so you will need to use the appropriate value for the temperature you are interested in. Additionally, different sources may provide slightly different values for the molar specific heat capacity, so it's always a good idea to consult multiple sources to get a sense of the range of possible values.

Answer: 0.5 g/cm^3

Density equals mass divided by volume so..

60/120 is 0.5 g/cm^3

Answer:

answers number 1

Explanation:

Answer

P2 = 9.84x10^-3 kPa

Explanation

Given:

Pressure 1 = 3.420x10^2 kPa

Volume 1 = 7.6100x10^-1 L

Temperature 1 = 1.8000x10^1 °C

Volume 2 = 1.91x10^4 L

Temperature 2 = 1.3000x10^1°C

Required: To calculate Pressure 2

Solution

We will use the combined gas law to solve this problem

Re-arrange to make the subject P2:

P2 = P1V1T2/V2T1

P2 = (3.420x10^2 x 7.6100x10^-1 x 1.3000x10^1)/(1.91x10^4 x 1.8000x10^1)

P2 = 9.84x10^-3 kPa

Based on the information provided, we have a reaction between hydrogen iodide (HI) gas and hydrogen gas (H₂) to form iodine gas (I₂). The equilibrium is represented by the equation:

2HI(g) = H₂(g) + I₂(g)

The concentration values given in the table correspond to the concentrations of H₂ and HI at different times.

a) From t=0 s to t=5 s: Without the specific graph mentioned in Figure 7.10, it is difficult to provide a precise explanation of the physical situation in the container during this time period. However, based on the equilibrium reaction given, we can make some general observations. At the start (t=0 s), the concentrations of H₂ and HI may be high. As time progresses, the reaction proceeds, and the concentrations of H₂ and HI may decrease while the concentration of I₂ increases. The specific behavior will depend on the rate of the forward and reverse reactions.

b) External factor altered at t=5 s: To bring about a change in the shape of the graph at t=5 s, some external factor must have been altered. The most likely factor is the total pressure within the container. Since the reaction involves gases, changes in pressure can affect the equilibrium position. However, according to the information given, a change in pressure will not affect equilibrium in this case since the number of moles of gas is the same on both sides of the equation. Therefore, if the shape of the graph changes at t=5 s, some other external factor, such as temperature or the addition of a catalyst, must have been altered.

c) Calculation of K at t=3 s: The equilibrium constant (K) can be calculated at any given time using the concentrations of the reactants and products. However, the concentrations of H₂ and HI at t=3 s are not provided in the information given. Without the necessary data, it is not possible to calculate K at t=3 s.

Lastly, the statement "1 dm³ COCI, decomposes" seems incomplete. If you provide additional information or clarify the question, I'll be happy to assist you further.

Answer:

lemme guess is it transportation??

Answer:

x/2

Explanation:

X = 2 molecules of H2

For 2 molecules of H2, there's only 1 molecule of O2. Meaning, there's twice the amount of H2, so O2 = x/2 molecules.

I hope I'm understanding this question right.

25.0grams of bromine is equivalent to 1.881 × 10²³ molecules.

The number of molecules of a substance can be calculated by multiplying the number of moles of the substance by Avogadro's number (6.02 × 10²³).

Avogadro's number is the number of atoms present in 12 grams of isotopically pure carbon-12, being 6.02214076 × 10²³. By definition, it is the number of elementary entities (atoms or molecules) comprising one mole of a given substance.

According to this question, sodium is combined with bromine to produce sodium bromide. If one uses 25.0g of bromine, the number of moles of bromine used is as follows:

no of moles = 25.0g ÷ 80g/mol

no of moles = 0.3125moles

no of molecules = 0.3125 × 6.02 × 10²³ = 1.881 × 10²³ molecules

Learn more about molecules at: https://brainly.com/question/28319191

#SPJ1

Answer:

5.25 grams of potassium sulfate will get crystallize out.

Explanation:

Solubility of potassium sulfate at 40 °C = 15 g/100 g

This means that at 40 °C 15 g of potassium sulfate will get completely dissolved in 100 of water.

39.0 g of potassium sulfate to 225 g water, carefully heating the solution.

Amount of potassium sulphate will get dissolve in 225 g of water at 40 °C will be:

\(\frac{15g}{100g}\) × 225 = 33.75g

Amount of potassium sulfate precipitated out by the solution:

= 39.0 g-33.75 g = 5.25 g

At 40 °C 5.25 g of potassium sulfate will get precipitate out from the solution which means that solution is saturated.

Saturated solution are solution in which solute is dissolved in maximum amount. Further addition of solute results in precipitation of solute form the solution.

5.25 grams of potassium sulfate will get crystallize out.

(Hope this Helps can I pls have brainlist (crown)☺️)

Answer:

D. Potential

Explanation:

Answer:

Potential

Explanation:

Gravitational potential is the energy the object has of it's position of the earth's surface. When the object is lifted, work is done.  When work is done in raising the height of an object, energy is transferred as a gain in the gravitational potential energy of the object.

The AH for the reaction 2NC1(g) +\(3H_{2}\)(g) → \(N_{2}\)(g) + 6HCl(g) using bond energies is -1,074 kJ/mol, indicating an exothermic reaction.

To predict the enthalpy change (AH) of the reaction using bond energies, we need to calculate the energy required to break the bonds in the reactants and the energy released when the products' new bonds are established.

The AH of the reaction is the difference between the energy required to break the bonds in the reactants and the energy released when new bonds are formed in the products.

The following is the chemically balanced equation for the reaction:

2NC1(g) + \(3H_{2}\)(g) → \(N_{2}\)(g) + 6HCl(g)

The bond energies that we need are:

Bond energies to break:

N≡C1: 305 kJ/mol

H-H: 436 kJ/mol

Bond energies to form:

N≡N: 946 kJ/mol

H-Cl: 431 kJ/mol

Now we can calculate the energy required to break the bonds in the reactants:

2(N≡C1)(305 kJ/mol) + 3(H-H)(436 kJ/mol) = 2(610 kJ/mol) + 3(436 kJ/mol) = 2,218 kJ

We can also calculate the energy released when new bonds are formed in the products:

1(N≡N)(946 kJ/mol) + 6(H-Cl)(431 kJ/mol) = 1(946 kJ/mol) + 6(431 kJ/mol) = 3,292 kJ

Therefore, the AH of the reaction is:

AH = energy released when new bonds are formed minus energy needed to break existing bonds.

= -1,074 kJ/mol

The exothermic nature of the reaction, or the release of energy, is indicated by the negative sign. Therefore, the AH of the reaction is -1,074 kJ/mol.

Learn More about exothermic reaction here:

https://brainly.com/question/2924714

#SPJ1

Answer:

0.000577 Mol/L

Explanation:

We know that;

ppm = moles/L * molar mass * 1000

It then follows that;

moles/L = ppm/molar mass  * 1000

ppm concentration = 63.3 ppm

molar mass = 329.3 g/mol

moles/L = 63.3 ppm/329.3 g/mol * 1000 * 3 moles of K^+

moles/L = 0.000577 Mol/L

To solve this problem, we need to use the balanced chemical equation for the reaction between zinc (Zn) and hydrochloric acid (HCl):

\(Zn + 2HCl - > ZnCl_2 + H_2\)

According to the stoichiometry of this equation, one mole of Zn reacts with two moles of HCl to produce one mole of H2. Therefore, we need to determine the number of moles of Zn in 25 g, and then use the mole ratio to find the number of moles of H2 produced.

Finally, we can convert the number of moles of H2 to volume at STP using the molar volume of a gas.

First, we need to calculate the number of moles of Zn in 25 g:

The molar mass of Zn is 65.38 g/mol

The number of moles of Zn in 25 g is:

25 g / 65.38 g/mol = 0.383 mol Zn

Next, we use the mole ratio from the balanced equation to find the number of moles of H2 produced:

According to the balanced equation, one mole of Zn reacts with one-half mole of H2, so we produce 0.5 x 0.383 = 0.192 mol H2.

Finally, we can use the molar volume of a gas at STP to convert the number of moles of H2 to volume:

The molar volume of a gas at STP is 22.4 dm3/mol

Therefore, the volume of H2 produced is:

V = (0.192 mol) x (22.4 dm3/mol) = 4.30 dm3 or 4,300 ml

Therefore, the volume of hydrogen gas produced at STP is 4.30 dm3 or 4,300 ml when 25 g of zinc is added to excess dilute hydrochloric acid at 31°C and 778 mm Hg pressure.

learn more about molar volume here

https://brainly.com/question/11676583

#SPJ1

Answer:

pH = 3.513

Explanation:

Hello there!

In this case, since this titration is carried out via the following neutralization reaction:

\(HONH_2+HCl\rightarrow HONH_3^+Cl^-\)

We can see the 1:1 mole ratio of the acid to the base and also to the resulting acidic salt as it comes from the strong HCl and the weak hydroxylamine. Thus, we first compute the required volume of HCl as shown below:

\(V_{HCl}=\frac{22.0mL*0.200M}{0.15M}=29.3mL\)

Now, we can see that the moles of acid, base and acidic salt are all:

\(0.0220L*0.200mol/L=0.0044mol\)

And therefore the concentration of the salt at the equivalence point is:

\([HONH_3^+Cl^-]=\frac{0.0044mol}{0.022L+0.0293L} =0.0858M\)

Next, for the calculation of the pH, we need to write the ionization of the weak part of the salt as it is able to form some hydroxylamine as it is the weak base:

\(HONH_3^++H_2O\rightleftharpoons H_3O^++HONH_2\)

Whereas the equilibrium expression is:

\(Ka=\frac{[H_3O^+][HONH_2]}{[HONH_3^+]}\)

Whereas Ka is computed by considering Kw and Kb of hydroxylamine:

\(Ka=\frac{Kw}{Kb}=\frac{1x10^{-14}}{9.10x10^{-9}} \\\\Ka=1.10x10^{-6}\)

So we can write:

\(1.10x10^{-6}=\frac{x^2}{0.0858-x}\)

And neglect the x on bottom to obtain:

\(1.10x10^{-6}=\frac{x^2}{0.0858}\\\\x=\sqrt{1.10x10^{-6}*0.0858}=3.07x10^{-4}M\)

And since x=[H3O+] we obtain the following pH:

\(pH=-log(3.07x10^{-4})\\\\pH=3.513\)

Regards!

The atomic mass of Sulphur is 80.1 amu ≈ 80 amu.

Atomic mass, also known as average mass in a bunch of atoms, is the total mass of the protons, neutrons, and electrons that make up an atom. However, because they are so much lighter than protons and neutrons, electrons are not taken into account in the computation. The mass of protons and neutrons together make up the atomic mass.

The mass of the elements present in the compound determines the percentage composition.

Sulfur mass equals 32.1 amu given

Oxygen mass = 16.0 amu

Sulfur trioxide mass is 32.1 + 3 × 16.0 = 80.1 amu.

To learn more about atomic mass refers to;

https://brainly.com/question/338808

#SPJ1

The concentration of CO2 in club soda is approximately 1.1964 g/L.

To find the concentration of CO2 in club soda, we need to use the stoichiometry of the reaction and the volume and concentration of the NaOH solution used.

The balanced equation for the reaction is:

CO2(aq) + 2NaOH(aq) → Na2CO3(aq)

From the stoichiometry of the equation, we can see that 1 mole of CO2 reacts with 2 moles of NaOH. Therefore, the moles of CO2 can be calculated using the volume and concentration of NaOH solution used.

Given that 32.14 mL of 0.04202 M NaOH solution was used, we can calculate the moles of NaOH:

moles of NaOH = volume (L) × concentration (M)

moles of NaOH = 32.14 mL × 0.04202 mol/L

moles of NaOH = 0.001351 mol

According to the stoichiometry of the equation, 1 mole of CO2 reacts with 2 moles of NaOH. Therefore, the moles of CO2 can be calculated as:

moles of CO2 = (moles of NaOH) / 2

moles of CO2 = 0.001351 mol / 2

moles of CO2 = 0.0006755 mol

Now, we need to convert the moles of CO2 to grams. The molar mass of CO2 is approximately 44.01 g/mol.

mass of CO2 = moles of CO2 × molar mass of CO2

mass of CO2 = 0.0006755 mol × 44.01 g/mol

mass of CO2 = 0.02979 g

Finally, we need to express the concentration of CO2 in club soda in g/L. We are given that the sample of club soda used is 25.00 mL.

concentration of CO2 = (mass of CO2) / (volume of club soda in L)

concentration of CO2 = 0.02979 g / (25.00 mL × 0.001 L/mL)

concentration of CO2 = 1.1964 g/L

For more such questions on concentration visit:

https://brainly.com/question/28564792

#SPJ8

Answer: 4.88 g/mol. and helium

Explanation:

To find the molar mass of the gas, we can use the ideal gas law equation which is PV=nRT where:

P = pressure = 2.000 atm

V = volume = 50.00 L

n = number of moles

R = gas constant = 0.08206 L·atm/K·mol

T = temperature = 273.15 K

First, we need to find the number of moles of the gas:

PV = nRT

n = PV/RT

n = (2.000 atm)(50.00 L)/(0.08206 L·atm/K·mol)(273.15 K)

n = 1.844 mol

Now, we can find the molar mass of the gas by dividing its mass by the number of moles:

molar mass = mass/number of moles

mass = 9.00 g

molar mass = 9.00 g/1.844 mol

molar mass = 4.88 g/mol

Therefore, the molar mass of the gas is 4.88 g/mol.

To determine what gas this is, we can compare the molar mass of the gas to the molar masses of known gases. The molar mass of 4.88 g/mol is closest to that of helium (4.00 g/mol). Therefore, this gas is most likely helium.