The ion with 86 electrons, 142 neutrons, and a 4+ charge

Step 1

Formulas used here:

-----------------

Step 2

From (1):

pOH = -log [OH-] = -log(1.0 x 10^-12 M) = 12

pOH = 12

-----------------

Step 3

From (2):

pH + pOH = 14 => pH = 14 - pOH = 14 - 12 = 2

pH = 2

------------------

Step 4

From (3):

[H3O+] = 10^-pH = 10^-2 = 0.01 M or 1x10^-2 M

Answer: [H3O+] = 0.01 M or 1x10^-2 M

Answer:

Pure substance

Explanation:

A material that consists of only one type of element or compound is regarded as a pure substance.

A pure substance has the following properties;

Compounds and elements are pure substances too.

Answer:

A. Nucleic Acids

Explanation:

This is because the nucleotides combine with each other to form a polynucleotide know as DNA or RNA.

The Fe^3+ is reduced in the reaction while the Al is oxidized in the reaction. The species that loses electrons (is oxidized) is called the reducing agent

A redox reaction (short for reduction-oxidation reaction) is a type of chemical reaction that involves the transfer of electrons between two or more species. In redox reactions, one reactant loses electrons (is oxidized) while another gains electrons (is reduced).

The species that loses electrons (is oxidized) is called the reducing agent, since it causes another species to be reduced. The species that gains electrons (is reduced) is called the oxidizing agent, since it causes another species to be oxidized.

Reduction half equation;

2Fe^3+(aq)  + 6e -----> 2Fe(s)

Oxidation half equation;

2Al(s) →2Al3+(aq) + 6e

Learn more about redox reaction:https://brainly.com/question/13293425

#SPJ1

Answer:

It is not possible for a bond to form between Fe (iron) and Cu (copper) as they are both metals and do not form covalent or ionic bonds with each other. They may form an alloy through a process called solid-state diffusion, but this is not a bond in the traditional sense.

CH₃CHCl₂COOH is 2,2-dichloropropanoic acid, with the least pH, option (c) is correct.

pH is a measure of the acidity or basicity of a solution. A lower pH indicates a higher acidity. Acidity is due to the presence of hydrogen ions (H⁺) in a solution. The more the concentration of H⁺, the lower the pH. CH₃CH₂COOH is propanoic acid, which has a pH of around 4.9.

CH₂ClCH₂COOH is 2-chloropropanoic acid, which has a pH of around 2.8 due to the electron-withdrawing effect of the chlorine atom. CH₃CH₂CH₂COOH is butanoic acid, which has a pH of around 4.8. Thus, CH₃CHCl₂COOH is 2,2-dichloropropanoic acid, which has the least pH among the given options, around 1.5 due to the presence of two electron-withdrawing chlorine atoms, option (c) is correct.

To learn more about pH follow the link:

https://brainly.com/question/491373

#SPJ1

Evaporation happens when a liquid substance becomes a gas. When water is heated, it evaporates. The molecules move and vibrate so quickly that they escape into the atmosphere as molecules of water vapor.

There are some particles in a liquid that have enough energy to escape the bonds to the other particles even below boiling point. This means they can move freely and turn into gas particles. The difference between boiling and evaporation is because boiling happens at a certain temperature and evaporation can happen at any temperature below boiling point.

#SPJ1

Answer:

[OH⁻] = 4.3 x 10⁻¹¹M in OH⁻ ions.

Explanation:

Assuming the source of the carbonate ion is from a Group IA carbonate salt (e.g.; Na₂CO₃), then 0.115M Na₂CO₃(aq) => 2(0.115)M Na⁺(aq) + 0.115M CO₃²⁻(aq). The 0.115M CO₃²⁻ then reacts with water to give 0.115M carbonic acid; H₂CO₃(aq) in equilibrium with H⁺(aq) and HCO₃⁻(aq) as the 1st ionization step.

Analysis:

            H₂CO₃(aq)     ⇄     H⁺(aq)    +    HCO₃⁻(aq); Ka(1) = 4.3 x 10⁻⁷

C(i)          0.115M                      0                  0

ΔC              -x                        +x                  +x

C(eq)    0.115M - x                   x                    x

            ≅ 0.115M

Ka(1) = [H⁺(aq)][HCO₃⁻(aq)]/[H₂CO₃(aq)] = [(x)(x)/(0.115)]M = [x²/0.115]M

= 4.3 x 10⁻⁷  => x = [H⁺(aq)]₁ = SqrRt(4.3 x 10⁻⁷ · 0.115)M = 2.32 x 10⁻⁴M in H⁺ ions.

In general, it is assumed that all of the hydronium ion comes from the 1st ionization step as adding 10⁻¹¹ to 10⁻⁷ would be an insignificant change in H⁺ ion concentration. Therefore, using 2.32 x 10⁻⁴M in H⁺ ion  concentration, the hydroxide ion concentration is then calculated from

[H⁺][OH⁻] = Kw => [OH⁻] = (1 x 10⁻¹⁴/2.32 x 10⁻⁴)M = 4.3 x 10⁻¹¹M in OH⁻ ions.

________________________________________________________

NOTE: The 2.32 x 10⁻⁴M  value for [H⁺] is reasonable for carbonic acid solution with pH ≅ 3.5 - 4.0.

The concentration of hydroxide ion of given solution is 4.3 x 10⁻¹¹M.

We can calculate the concentration of hydroxide ions as follow:

[OH⁻][H⁺] = 10⁻¹⁴

Given chemical reaction with ICE table shown as below:

                H₂CO₃(aq)     ⇄     H⁺(aq)    +    HCO₃⁻(aq)

Initial:             0.115                      0                    0

Change:           -x                        +x                  +x

Equilibrium:  0.115-x                   +x                  +x

Given that, Ka = 4.3 x 10⁻⁷

Equilibrium constant for this reaction is written as:

Ka = [H⁺][HCO₃⁻]/[H₂CO₃]

4.3 x 10⁻⁷ = x² / 0.115

x = 2.32 x 10⁻⁴M = [H⁺]

Now we calculate the concentration of hydroxide ion as:

[OH⁻][H⁺] = 10⁻¹⁴

[OH⁻] = 10⁻¹⁴ / 2.32 x 10⁻⁴ = 4.3 x 10⁻¹¹M

Hence, value of [OH⁻] is 4.3 x 10⁻¹¹M.

To know more about pH & pOH, visit the below ink:

https://brainly.com/question/24595796

Answer:

I would serve nothing

Explanation:

thank you bye\

Answer:

Explanation:

I would not serve it because what if Their is some dangerous chemical

Answer:

False

Explanation:

The given statement stating that resistance  is the slowing of the flow of electrons and where some of the electrical energy is converted into heat is true and it is a opposite of conduction.

Conduction is defined as a process as a means of which heat is transferred from the hotter end of the body to it's cooler end.Heat flows spontaneously from a body which is hot to a body which is cold.

In the process of conduction,heat flow is within the body and through itself.In solids the conduction of heat is due to the vibrations and collisions of molecules while in liquids and gases it is due to the random motion of the molecules .

When conduction takes place, heat is usually transferred from one molecule to another as they are in direct contact with each other.There are 2 types of conduction:1) steady state conduction 2) transient conduction.According to the type of energy conduction is of three types:

1) heat conduction

2) electrical conduction

3)sound conduction

Learn more about conduction,here:

https://brainly.com/question/12136944

#SPJ5

Answer:

CO2 is the chemical formula for the compound carbon dioxide. C is the symbol for the element carbon, and O is the symbol for oxygen.

Explanation:

Carbon Dioxide has One Carbon and Two Oxygens.

The volume (in mL) of 0.100 M Na₂CO₃ needed to produce 1.00 g of CaCO₃ is 100 mL

First, we shall determine the mole in 1.00 g of CaCO₃. Details below:

Mole = mass / molar mass

Mole of CaCO₃ = 1 / 100.09

Mole of CaCO₃ = 0.01 mole

Next, we shall obtain the mole of Na₂CO₃. Details below:

Na₂CO₃ + CaCl₂ -> 2NaCl + CaCO₃

From the balanced equation above,

1 mole of CaCO₃ were obtained from 1 mole of Na₂CO₃

Therefore,

0.01 moles of CaCO₃ will also be obtain from 0.01 mole of Na₂CO₃

Finally, we shall determine the volume of Na₂CO₃ needed. Details below:

Volume = mole / molarity

Volume of Na₂CO₃ = 0.01 / 0.1

Volume of Na₂CO₃ = 0.1 L

Multiply by 1000 to express in mL

Volume of Na₂CO₃ = 0.1  1000 =

Volume of Na₂CO₃ = 100 mL

Learn more about volume:

https://brainly.com/question/29144710

#SPJ1

The mass of the asteroid is C. 1.2 x \(10^{12}\) Kg

To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:

F = (G * m1 * m2) / \(r^{2}\)

where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.

Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x \(10^{7}\) kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):

1.14 N = (6.67430 × \(10^{-11}\) N \(m^{2}\)/\(Kg^{2}\) * 8 x \(10^{7}\) kg * \(m2\)) / \((75000 m)^{2}\)

Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x \(10^{12}\) kg. Therefore, Option C is correct.

The question was incomplete. find the full content below:

Two asteroids are 75000 m apart one has a mass of 8 x \(10^{7}\) kg if the force of gravity between them is 1.14 what is the mass of the asteroid

A. 3.4 x \(10^{11}\) kg

B. 8.3 x \(10^{12}\) kg

C. 1.2 x \(10^{12}\) kg

D. 1.2 x \(10^{10}\) kg

Know more about gravitational force here:
https://brainly.com/question/72250

#SPJ8

Answer: They share electrons and become bonded together.

Explanation: Most interactions among atoms take place in the outermost shell of each atom. The number of each electron in this shell determines how an atom combines with other atoms to form compounds. When atoms combine they gain, lose or share electrons in such a way that the outer shells become chemically complete.

Answer:

Heat energy will flow from the plastic sphere to the water. This is because heat energy always flows from a warmer object to a cooler object.

Explanation:

In this case, the plastic sphere has a higher temperature of 85 °C, while the water has a lower temperature of 15 °C. Therefore, heat energy will naturally flow from the plastic sphere to the water until both objects reach thermal equilibrium, where they have the same temperature. As a result, the plastic sphere will cool down and the water will warm up until they reach the same temperature.

Answer

By adding water (H2O)

Explanation

In this reaction, water is a product, adding the product will favour the reverse reaction, which is the formation of more Co(H2O)6^2+.

Answer:

\((n-1)\frac{1}{5}\)

Explanation:

n = number

So the difference is just (n-1) of is another way of saying multiply that means we would multiply (n-1)1/5

Hope that helps and have a great day!

The one-fifth of the difference of a number and 1 is :

\(=\frac{1}{5}\times (N-1)=\frac{N}{5}-\frac{1}{5}\)

Explanation:

Given:

Any arbitrary number.

To find:

One-fifth of the difference of number and 1.

Solution:

Let the number be N.

The term 'difference' simply means to subtract.

The difference between number 'N' and 1 will be:

= N-1

One-fifth of the difference between number 'N' and 1 will be determined by multiplying the difference by 1/5:

\(=\frac{1}{5}\times (N-1)=\frac{N}{5}-\frac{1}{5}\)

The one-fifth of the difference of a number and 1 is :

\(=\frac{1}{5}\times (N-1)=\frac{N}{5}-\frac{1}{5}\)

Learn more about algebra here:

brainly.com/question/953809?referrer=searchResults

brainly.com/question/21261790?referrer=searchResults

The pressure of 1.27 L of a gas at 288°C, if the gas had a volume of 875 ml at 145 kPa and 176°C is 1.195 atm.

Ideal gas equation of any gas will be represented as:
PV = nRT, where

P = pressure

V = volume

n = moles

R = universal gas constant

T = temperature

First we calculate the moles of gas, when the volume of gas 875 ml at

145 kPa and 176°C as:

n = (1.431atm)(0.875L) / (0.082L.atm/K.mol)(449.15K)

n = 1.252 / 36.83 = 0.033 moles

Now we measure the pressure of 0.033 moles of gas of 1.27 L of a gas at 288°C as:

P = (0.033mol)(0.082L.atm/K.mol)(561K) / (1.27L) = 1.195 atm

Hence required pressure of gas is 1.195 atm.

To know more about ideal gas equation, visit the below link:
https://brainly.com/question/555495

#SPJ1

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

There are 2.81 × 10^24 moles number of carbon atoms in a 140.0 g sample of glucose (C6H1206).

The term molar mass of a substance is defined as the mass in grams of one mole of the compound. In a substance, the amount of entities present e.g., atoms, molecules, ions. A mole of any substance is 6.022×10²³ molecules.

To calculate, we need to know the number of moles present in 140 grams of carbon.

number of moles = mass/molar mass

molar mass of glucose is = 180 g/mol

Therefore, the number of moles will be ;

140/180 = 0.7778 mole

1 mole of glucose contains 6 moles of carbon;

Then, 0.7778 moles will contain = 4.667 moles

the number of atoms in 1 mole is 6.02 × 10^23 atoms

The number of atoms in 4.667 moles will be :

4.667 × 6.02 × 10^23

= 2.81 × 10^24 atoms

Thus, 2.81 × 10^24 moles number of carbon atoms in a 140.0 g sample of glucose (C6H1206).

To learn more about the molar mass, follow the link;

https://brainly.com/question/12127540

#SPJ9

Answer:

Gas in motion : Vaporization

Examples of fluid flow :

Explanation:

Answer:

Granules of the hair cortex.

Explanation:

Answer:

It is banding for plato / edmentum

Explanation:

I took notes in the class and in my notes it says -

Human hairs have consistent coloring, whereas animal hair coloring may change radically. This radical change is called banding.

Answer:

\(\huge\boxed{\sf CNH_4}\)

Explanation:

Given compound us,

C₂N₂H₈

= 2 : 2 : 8

= 2 ÷ 2 : 2 ÷ 2 : 8 ÷ 2

= 1 : 1 : 4

So, we can write the formula as:

\(\rule[225]{225}{2}\)

Answer: Yes

Explanation:

Answer:

I believe the correct answer is cold surfaces.

Explanation:

Answer:

C

Explanation:

The branch of science which deals with chemical bonds is called chemistry.

The correct answer to the question is rancidity.

The process of decomposition of the edible items in presence of air which gives a bad odor is called rancidity.

The canned baked items are less prone to rancidity because they have preservation and nitrogen gas in them which prevent them from decomposition.

When the food reacts with the air it starts to decomposition due to oxidation.

Hence, canned baked last longer than the can in the air.

For more information, refer to the link:-https://brainly.com/question/25026730

Ancef (Cefazolin) is a first-generation cephalosporin antibiotic that is used to treat bacterial infections. Cefazolin is available in several formulations, including injectable, intravenous, and powder for injection.

For such more question on  antibiotic

https://brainly.com/question/11849121

#SPJ8