Which population of frogs will best survive a change in the environment?

The statement "All organic compounds contain the element carbon, but not all compounds containing the element 'carbon' are organic" can be justified based on the definition and characteristics of organic compounds.

Organic compounds are compounds primarily composed of carbon and hydrogen atoms, often with other elements like oxygen, nitrogen, sulfur, and phosphorus. These compounds are typically associated with living organisms and are known for their unique properties and behavior, including the ability to form complex structures, exhibit covalent bonding, and undergo organic reactions.

On the other hand, there are compounds that contain carbon but are not classified as organic. One notable example is carbon dioxide (\(CO_{2}\)), which is a simple inorganic compound composed of carbon and oxygen. Carbon dioxide does not possess the characteristic properties of organic compounds, such as the ability to form long chains or undergo organic reactions.

Additionally, there are inorganic compounds like carbonates (such as calcium carbonate) and carbides (such as calcium carbide) that contain carbon but are not considered organic. These compounds have distinct chemical and physical properties different from those of organic compounds.

In summary, while all organic compounds contain carbon, not all compounds containing carbon are organic. The classification of a compound as organic or inorganic depends on its overall molecular structure, bonding, and characteristic properties.

Know more about molecular structure here:

https://brainly.com/question/27789666

#SPJ8

Answer:

1.17 moles H₂SO₄

Explanation:

To find the moles H₂SO₄, you need to multiply the given value by the mole-to-mole ratio. This ratio is made up of the coefficients of the relevant molecules from the balanced chemical equation. It is important to arrange the ratio in a way that allows for the cancellation of units.

S + 6 HNO₃ ------> 1 H₂SO₄ + 6 NO₂ + 2 H₂O
     ^                      ^

7 moles HNO₃          1 mole H₂SO₄
-----------------------  x  ------------------------  =  1.17 moles H₂SO₄
                                  6 moles HNO₃

Answer:

28645 years

Explanation:

Given the formula;

0.693/t1/2 = 2.303/t log (No/N)

Given that N = 1/32 No

Note;

t1/2 = half life of Carbon-14

t = time required for N amount of carbon -14 to remain= 5,730 years

No= amount of carbon 14 initially present

N = amount of carbon-14 after time t

Substituting values;

0.693/5,730 = 2.303/t log (No/1/32No)

0.693/5,730 = 2.303/t log 32

1.21 * 10^-4      = 3.466/t

t = 3.466/1.21 * 10^-4

t = 28645 years

Any preserved imprints, remains and traces of once a living organism from history are called fossils. By utilizing the radioactive property of organic compounds one can determine the age of an object.

The approximate age of the fossilizes remain is 28645 years.

This can be estimated as:

The formula used will be:

\(\dfrac{0.693}{\dfrac{t1}{2}}= \dfrac{2.303}{t} log (\dfrac{No}{N})\)

Where,

Given,

N = \({\dfrac{1}{32} No\)

Replacing values in formula:

\(\dfrac{0.693}{5,730} & = \dfrac{2.30}{t} log \:({{\dfrac{No}{\dfrac{1}{32} No}})\)

\(\dfrac{0.693}{5,730} & = \dfrac{2.30}{t} \;log 32\)

\(1.21 \times 10^{-4} = \dfrac{3.466}{t}\)

\(t = \dfrac{3.466}{1.21} \times 10^{-4}\)

\(t = 28645 \:\text{years}\)

Therefore, the approximate age of the fossil is 28645 years.

To learn more about fossils and their age follow the link:

https://brainly.com/question/8917701

Answer:

No. of H atoms in 0.51 moles of H+ = 3.0713 * 10^23 atom

Explanation:

according to the definition of mole which states that the mole is the unit of amount of substance that equals Avogadro's number"Na = 6.022 * 10^23" (i.e. one mole of O2 contains 1Na of molecules, one mole of Ca = 1Na of atoms )

So

the number of atoms in 0.51 moles of H = 0.51 * 6.022 * 10^23 = 3.0713 * 10^23 atom

you can use this method to balance any equation,

write you elements down , then start balancing them one after the other,

starting from metals , to non metals

it's better to balance hydrogen and oxygen the last and in most cases , they are automatically balanced

you can support by rating brainly it's very much appreciated ✅

Answer:

First, we need to determine the molar mass of HCl.

The molar mass of HCl = the mass of hydrogen (1.008 g/mol) + the mass of chlorine (35.45 g/mol) = 36.45 g/mol.

Next, we can use Avogadro's number (6.02 x 10^23 molecules/mol) to convert the number of molecules to moles:

6.02 x 10^24 molecules / 6.02 x 10^23 molecules/mol = 10 moles

Finally, we can use the molar mass to convert moles to grams:

10 moles x 36.45 g/mol = 364.5 grams

Therefore, the mass of 6.02 x 10^24 molecules of HCl is 364.5 grams.

D. 62.8 J

Math

Pre-Algebra

Order of Operations: BPEMDAS

Chemistry

Thermodynamics

Specific Heat Formula: q = mcΔT

Step 1: Define

[Given] m = 0.750 g

[Given] c = 4.186 J/g °C

[Given] ΔT = 40.0 °C - 20.0 °C = 20.0 °C

[Solve] q

Step 2: Solve

Step 3: Check

Follow sig fig rules and round. We are given 3 sig figs.

62.79 J ≈ 62.8 J

The expression 7.0x\(10^7\) ÷ 2.0x\(10^4\) can be expressed in proper scientific notation as 3.5x10^3.

To express the division 7.0x\(10^7\) ÷ 2.0x\(10^4\) in proper scientific notation, we need to perform the division and adjust the result to the appropriate format.

Dividing the numbers, we get:

7.0x\(10^7\) ÷ 2.0x\(10^4\)= 3.5x\(10^{(7-4)\)= 3.5x\(10^3\)

The result of the division is 3.5, and we adjust the exponent by subtracting the exponent of the divisor from the exponent of the dividend (7 - 4 = 3).

Therefore, the proper scientific notation representation of the division 7.0x\(10^7\) ÷ 2.0x\(10^4\) is 3.5x\(10^3\).

Scientific notation is a way to express numbers using a coefficient (in this case, 3.5) multiplied by a power of 10 (in this case, 10^3). It allows for more concise representation of very large or very small numbers.

In this case, the division resulted in a number that is smaller than the dividend and has a positive exponent, indicating a smaller magnitude compared to the original numbers. The coefficient represents the significant digits of the result, while the power of 10 represents the scale or magnitude of the number.

For more such questions on scientific notation visit:

https://brainly.com/question/28468914

#SPJ8

The chemical equation for the reaction 2H⁺(aq) + S₂⁻(aq) → H₂S(g) can be represented as 2H⁺(aq) + S₂⁻(aq) → H₂S(g).

A chemical equation uses symbols and formulas to express a chemical reaction. It displays the products on the right side of the arrow and the reactants on the left.

For example, in the chemical equation

2H₂(g) + O₂(g) → 2H₂O(l),

represents the reaction between hydrogen gas (H2) and oxygen gas (O₂) to produce liquid water (H₂O). The coefficient "2" in front of H₂ and H₂O indicates that two molecules of hydrogen gas and two molecules of water are involved in the reaction.

The equation is balanced using coefficients to make sure that each element has the same amount of atoms on both sides. The substances involved in the reaction and their stoichiometric relationship are described by chemical equations.

Learn more on chemical equation here https://brainly.com/question/11904811

#SPJ1

Here are 3 alkali metals with physical and chemical similarity.

What is alkali metals?

alkali metals are come from the fact that when these metals or their oxides dissolved in water.a basic solution results.

Three alkali metals -

1- hydrogen(H)

2-lithium(Li)

3-potassium(K)

Physical and chemical similarity of hydrogen -

-it is colourless and tasteless in nature.

-it is a combustible gas but not a supporter of combustion.

Physical and chemical similarity of lithium -

-it have a melting point of 180.54

-it is the lightest of all metals,with a density approximately half that of water.

Physical and chemical similarity of pottasium -

- this metal is soft and white with a silver lustre.

-it imparts a lavender colour to a flame, and it's vapour is green.

To know more about alkali metals click-

https://brainly.com/question/19109836

#SPJ9

Answer:

thanks

Explanation:

thanks

The formula units corresponds to the molecules of a substance, there is a relationship between moles and molecules, this relationship is Avogadro's number.

Avogadro's number tells us that a mole of any substance contains 6.022x10^23 molecules. Therefore in 16.4 moles of Kbr there will be:

The number of formula units of Kbr in 16.4 moles is 9.87x10^24

Answer:

hydrochloric acid

Explanation:

If the hydrochloric acid used on cuts and scrapes for sanitation were to be very high in concentration. It would still kill bacteria it would just also start to burn through your skin.

One mole of radiant energy will supply 6.02 x 10^23 photons.

The number of photons is calculated by dividing the overall energy of a pulse by the energy of one photon included inside the pulse.

As a result, an electromagnetic energy particle is known as a photon. Photons have no mass, thus they move at the same rate as light.

we need to first calculate the total energy in one mole of photons,

By combining the energy per photon with Avogadro's number (6.022 x 1023), one may determine the energy of a mole of photons:

Energy per mole of photons = Energy per photon x Avogadro's number

we can calculate the energy per mole of photons:

Energy per mole of photons = 3.37 × 10−19 J x 6.022 x 10^23

Energy per mole of photons = 2.03 x 10^5 J/mol

Number of photons in one mole = Energy per mole of photons / Energy per photon

Number of photons in one mole = 2.03 x 10^5 J/mol / 3.37 × 10−19 J

Number of photons in one mole = 6.02 x 10^23 photons/mol

To know more about the photon visit:

https://brainly.com/question/12015967

#SPJ1

The question is incomplete, the complete question is;

A student determines the number of moles of water in a

hydrated metal oxide by weighing a clean, dry crucible

and lid while the crucible is empty, then reweighing the

crucible and lid with a sample of the hydrate, heating the

crucible and lid with a Bunsen burner and then

reweighing the crucible and lid with the sample after

cooling to room temperature. Which error will result in

too high a value for the amount of water of hydration?

(A) The heating is conducted only once instead of the

three times recommended by the procedure.

(B) The lid is left off the crucible when it is weighed

with the hydrated oxide.

(C) The metal oxide reacts partially with oxygen in the

air, forming a compound in a higher oxidation state.

(D) Some of the heated oxide is spilled from the crucible

before it can be weighed.

Answer:

(D) Some of the heated oxide is spilled from the crucible

before it can be weighed.

Explanation:

It is possible to determine the number of moles of water in a hydrated metal oxide by weighing a clean, dry crucible and lid while the crucible is empty, then reweighing the crucible and lid with a sample of the hydrate. The crucible and lid with the sample are heated, cooled and reweighed.

As this process is going on, suppose some of the heated oxide is spilled from the crucible, then the mass of heated or anhydrous oxide decreases leading to a consequent increase in the number of moles of water in the hydrated metal oxide, hence the answer above.

The too high a value for the amount of water of hydration error is occur due to heating of given hydrated sample.

Hydrated compounds are those compounds in which water molecule is present with the normal compound.

To get the correct value of weight of hydrated compound, first we have to weigh the empty crucible and lid and then with sample of compound in the crucible and lid. After this substract empty weigh of crucible & lid from the sample-crucible-lid weigh. If we substract the weigh from heated sample crucible and lid, then we get the error because the hydrated water molecule may decompose due to heating and moles of water increases.

Hence, error will occur if we heat the sample.

To know more about hydrated compound, visit the below link:

https://brainly.com/question/16275027

Answer:

none of the above

Explanation:

deposition (gas to solid), sublimation (solid to gas), evaporation, this all is physical change not chemical change

Answer:

The gases in a hair spray can are at a temperature of 26.0 °C and a pressure of 25.0 lbs/in2.

If the pressure becomes \(90.0lbs/in^{2}\), what is the temperature of the gases?

Explanation:

According to Gay lussac's law:

the pressure of a gas is directly proportional to its absolute temperature.

\(P\alpha T\)

\(\frac{P{1} }{T{1} }=\frac{P{2} }{T{2} }\)

Given,

\(P1=25.0lbs/in^{2} \\P2=90.0lbs/in^{2} \\T1=26^{o} C=(26+273)K=299K\\T2=?\)

Substitute these values in the above formula:

\(\frac{P{1} }{T{1} }=\frac{P{2} }{T{2} }\\\\\frac{25lbs/in^{2} }{299K} }=\frac{90.0lbs/in^{2} }{T{2} }\\\\\\On simplification \\T2=1076.4K\\T2=(1076.4-273)^{o} C=803.4^{o} C\)

Answer:

The gases will be raised to a temperature of 803.4\(^{o} C\).

Answer:

9.26g of BaSO₄ are formed

Explanation:

The reaction of Ba(OH)₂ with H₂SO₄ is:

Ba(OH)₂ + H₂SO₄ → BaSO₄ + 2H₂O.

To solve this question we need to determine the moles of each reactant in order to find the limitng reactant. With the moles of limiting reactant we can find the theoretical moles of BaSO₄ produced and its mass, as follows:

Moles Ba(OH)₂:

50.0mL = 0.050L * (1.00mol / L) = 0.0500moles

Moles H₂SO₄:

83.5mL = 0.0835L * (0.475mol / L) = 0.0397moles

That means limiting reactant is H₂SO₄.

Based on the reaction, 1 mole of H₂SO₄ produce 1 mole of BaSO₄. The theoretical moles of BaSO₄ produced are 0.0397 moles.

The mass is (Molar mass BaSO₄: 233.38g/mol):

0.0397 moles BaSO₄ * (233.38g / mol) =

Answer: The heat of combustion per gram of the material is 53.5 kJ

Explanation:

Let the heat released during reaction be q.

\(q=m\times c\times \Delta T\)

\(q_{cal}\) = Heat gained by calorimeter

Heat capacity of bomb calorimeter ,C = 38.29 kJ/°C  

Change in temperature = ΔT = (27.04-23.61) °C = 3.43 °C

\(q_{cal}=C_{bomb}\times \Delta T=38.29\times 3.43=131.3kJ\)

Total heat released during reaction is equal to total heat gained by bomb calorimeter.

\(q_{combustion}=-(q_{cal})\)

\(q_{combustion}=-(131.3)J\)

Thus 2.455 g of material releases 131.3 kJ of heat

1 g of material releases =\(\frac{131.3}{2.455}\times 1=53.5kJ\) of heat

Thus the heat of combustion per gram of the material is 53.5 kJ

Considering the definition of empirical and molecular formula, if the molecular formula mass of the compound is 60.0 g/mol, the molecular formula is N₂O₂.

The empirical formula is the simplest expression to represent a chemical compound, which indicates the elements that are present and the minimum proportion in whole numbers that exist between its atoms.

The molecular formula is the chemical formula that indicates the number and type of distinct atoms present in the molecule. The molecular formula is the actual number of elements that make up a molecule.

The empirical formula and the molecular formula are generally related in the following way:

Molecular Formula = n× Empirical Formula

where n is n=molecular mass÷ empirical mass

In this case, in first place you need to convert the number of grams given into percentage as follow:

Assuming a 100 grams sample, the percentages match the grams in the sample. So you have:

Then it is possible to calculate the number of moles of each atom in the molecule, taking into account the corresponding molar mass:

The empirical formula must be expressed using whole number relationships, for this the numbers of moles are divided by the smallest result of those obtained. In this case:

Therefore the N: O mole ratio is 1: 1

Finally, the empirical formula is N₁O₁= NO

The molecular mass is 60.0 g/mol and the empirical mass is 30 g/mole. Then, the value of n is:

n=60 g/mole÷ 30 g/mole

Solving:

n=2

Being the Molecular Formula = n× Empirical Formula, the you can calculate:

Molecular Formula = 2× (NO)

Molecular formula= N₂O₂

Finally, the molecular formula is N₂O₂.

Learn more about empirical and molecular formula:

https://brainly.com/question/13058832

#SPJ1

In 18.4 liters of neon gas at STP, you have16.42g of the gas.

Reason: A MOLAR quantity of gas is defined as a volume of 22.4 L of gas at standard conditions of pressure and temperature (1 atm, 273.15 K). That means, each helium atom has a mass of 6.022 1023.

To determine the value of moles, use the ideal gas law.

The ideal gas law is PV=nRT

T is the temperature in Kelvin which 273 K for standard conditions.

Rearrange the equation to solve for n

n = PV/RT

n = ( 1 atm) ( 18.4L)/[(0.0821 L atm/mol K)(273)]

n=0.821 moles of Neon gas

mass of neon= 0.821*20g

mass of neon= 16.42g

To know more about moles visit:-

https://brainly.com/question/20486415

#SPJ1

Answer: 0.85 hertz

Explanation: Calculator said so also 0.85 is decimal form for 85

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Because the speed limit sign is in kilometres per hour and the driver is accustomed to miles per hour, no other cars are passing too quickly. The permitted speed is roughly 62 mph.

A regulatory sign is the speed limit sign. The purpose of speed limit signs is to inform drivers of the legal maximum and minimum speeds that are required of them. Drivers are not permitted to go over the limit stated by the sign.

When approaching or passing a troop, police, or military procession, or when driving past construction workers fixing roads, a motor vehicle's driver must travel at a pace of no more than 25 kph.

To know more about limit visit:-

https://brainly.com/question/27439796

#SPJ1

Answer:

4 sig figs: 20.18

Explanation:

the smallest amount of digits was 4 in the expression

Answer: 20.2

Explanation:

you round that to the nearest and it's 20.2

Answer:

4.70 moles of water have mass of 84.6g

Explanation:

Given data:

Number of moles of water = 4.70 mol

Mass in gram = ?

Solution:

Formula:

Mass = number of moles × molar mass

Molar mass of water is 18 g/mol

Mass = 4.70 mol × 18 g/mol

Mass = 84.6 g

Thus, 4.70 moles of water have mass of 84.6g.

Answer:

B. Argon has similar properties to neon.

Explanation:

hope it helps u.

The statement of element has properties similar to neon is "argon."

A substance that cannot be split into smaller components using normal chemical processes. Elements are chemical compounds that correspond to a single spot on the current periodic table. Elements are made up of only one type of atom.

Argon, like neon, is classified as a noble gas. That is, argon is a member of the noble gas family of chemicals.

Both neon and argon are positioned in the group 8, which means they have eight electrons in their outermost electron shell, making them noble and inert gases. They are very nonreactive since they already have a complete and stable octet structure and don't need to connect to other elements.

Hence the correct option is B.

Learn more about element here

https://brainly.com/question/13794764

#SPJ2

Answer:

Most aren't able to take in carbon dioxide gas from the air or produce any oxygen.

Explanation:

science bro