calcium silicate reacts with hydrofluoric acid to form calcium fluoride, silicon tetrafluoride and water. if 25.2-g of calcium silicate reacts with 16.0-g of hydrofluoric acid, how many grams of calcium fluoride will be recovered at the end of the reaction?

Explanation:

Physical change can observe by physical appearance

OA = No change in color

other choices are chemistry change

Answer:

because the ions arent firmly held in place!

Explanation:

The mass of \(CO_{2}\) in 1000 L of the atmosphere at 298 K is 1765.14 g

To calculate the mass of \(CO_{2}\) in 1000 L of the atmosphere at 298 K and a total atmospheric pressure of 1.00 atm, we need to use the ideal gas law:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles of gas, R is the gas constant, and T is the temperature.

We know that the total pressure is 1.00 atm and the volume is 1000 L, so we can rearrange the equation to solve for the number of moles of \(CO_{2}\):

n = PV/RT

Plugging in the values, we get:

n = (1.00 atm)(1000 L)/(0.0821 L·atm/mol·K)(298 K)
n = 40.14 mol

Now we can use the molar mass of CO2 (44.01 g/mol) to calculate the mass of \(CO_{2}\) in grams:

mass = n × molar mass
mass = 40.14 mol × 44.01 g/mol
mass = 1765.14 g

Therefore, the mass of \(CO_{2}\) in 1000 L of the atmosphere at 298 K and a total atmospheric pressure of 1.00 atm is 1765.14 grams or 1.77 kg (rounded to two decimal places).

Know more about Molar mass here :

https://brainly.com/question/837939

#SPJ11

Answer:

It is 823.5

Explanation:

your welcome

Answer:

The awnser is a single called organism

Explanation:

The above picture shows a a single-celled organism. Specifically, it is a protozoan with many cilia, which are the small white hair-like projections.

The compound that can exhibit cis-trans isomerism is D) [Ni(CO)₂(NH₃)₂]²⁺ because it has different spatial arrangements of the same ligands around the central metal atom.

Cis-trans isomerism occurs when a compound has different spatial arrangements of the same ligands around a central metal atom. For cis-trans isomerism to be possible, the coordination complex must have a square planar or octahedral geometry and at least two different types of ligands.

Among the given options, only D) [Ni(CO)₂(NH₃)₂]²⁺ satisfies these requirements. It has a square planar geometry, with two CO and two NH₃ ligands coordinated to the Ni(II) ion. Therefore, it can form cis and trans isomers depending on the relative positions of the CO and NH₃ ligands around the central metal atom.

Learn more about isomerism here:

https://brainly.com/question/14063244

#SPJ11

The  2.0 ml pipet transfers the 0.10 M stock solution to the 25.0 ml volumetric flask which is then diluted. The molar concentration of the diluted copper solution is 0.008 M.

The initial molar concentration, M₁ = 0.10 M

The initial volume , V₁ = 2.0 mL

The final molar concentration, M₂ = ?

The final volume, V₂ = 25.0 mL

The expression is as follows :

M₁ V₁ = M₂ V₂

M₂ = M₁ V₁ /  V₂

M₂ = (0.10 × 2 ) / 25

M₂ = 0.008 M

Thus, the molar concentration of the diluted copper solution is 0.008 M.

To learn more about concentration here

https://brainly.com/question/20910830

#SPJ4

Answer:

Water particles have strong intermolecular forces.

Explanation:

Water molecules are affected by attraction and repulsion and that causes the water to have strong forces and intermolecular strength to be strong.

Water particles have strong intermolecular forces.

Intramolecular forces are the forces that keep atoms together inside a molecule. Intermolecular forces are forces that exist among molecules. determine intermolecular appeal between H-Cl molecules and intramolecular attraction within H-Cl molecules.

The most powerful intermolecular forces are dipole-dipole interactions. A dipole-dipole pressure is while the high-quality aspect of a polar molecule draws the bad facet of every other polar molecule.

Learn more about intermolecular forces here: https://brainly.com/question/25920008

#SPJ2

Answer: The part I think you messed up on is the atoms not all of them have 0 and 1. Sodium Chloride has 2 atoms. Other than that it looks amazing! Hope this helps!

Answer:

Carbon has 4 electrons in its outermost shell. ... Therefore, carbon completes its octet by sharing its 4 electrons with other carbon atoms or with atoms of other elements and forms covalent bond. It forms strong covalent bonds because of its small size.

Explanation:

When filling a buret for a titration, first adjust the buret in the clamp so that it is vertical. Then, choose an appropriate funnel to add the titrant into the buret. The titrant should be filled to just above the zero mark on the buret, and the buret tip should be briefly opened to remove any bubbles.

After that, the buret can be adjusted to the desired volume and the titration can proceed. It is important to take note of the initial buret reading before starting the titration to ensure accurate measurement of the titrant volume.

When filling a buret for a titration, it is important to first adjust the buret in the clamp so that it is vertical and its tip is below eye level to ensure accurate volume measurements. Next, choose an appropriate method to add the titrant into the buret, such as using a funnel or a pipette.

It is important to avoid splashing or spilling the titrant to ensure accurate and precise measurements. The titrant should be filled above the zero mark on the buret and then slowly drained until the bottom of the meniscus is aligned with the zero mark.

This process is called "buret priming" and it helps to remove any air bubbles from the buret tip that can affect the accuracy of the measurements. Once the buret is primed and filled with the titrant, it is ready to be used for the titration.

For more question on titration click on

https://brainly.com/question/16839748

#SPJ11

We need 128.04 grams of Al2(SO4)3.18H2O to make 800 mL of a 0.300 M solution. Given that the volume of the solution (V) = 800 mL = 0.8 L

The molarity of the solution (M) = 0.300 M

We have to find out the mass of the compound Al2(SO4)3.18H2O required to make the solution.

To find the mass, we need to use the formula:

mass = molarity x molar mass x volume

Here, the molar mass of Al2(SO4)3.18

H2O = 666.39 g/mol (sum of the atomic weights of Al, S, O, and H)

Let the mass of the compound be x grams. Substituting the given values in the above formula:

mass = 0.300 x 666.39 x 0.8

= 160.05 x 0.8

= 128.04 g

To leran more about molarity, refer:-

https://brainly.com/question/30909953

#SPJ11

Answer:

Explanation:

................

Answer:

P₄O₁₀

Explanation:

The molecular formula of phosphorus pentooxide is P₄O₁₀

The pH of 0.779 M ethylammonium chloride (C2H5NH3Cl) is 10.08. What is ethylammonium chloride? Ethylammonium chloride is a chloride salt that is formed from the reaction between ethylamine and hydrochloric acid.

Ethylamine (C2H5NH2) is the primary component in the synthesis of ethylammonium chloride. When ethylamine is added to hydrochloric acid, a white solid is formed that has the chemical composition C2H5NH3Cl.How to find pH of ethylammonium chloride?The Kb value for ethylamine is given as 4.3 x 10^-4.

The reaction for ethylamine is:C2H5NH2(aq) + H2O(l) ⇌ C2H5NH3+(aq) + OH-(aq)We can assume that ethylammonium chloride is completely ionized. So, we can write:C2H5NH3Cl → C2H5NH3+ + Cl-The hydrolysis of the ethylammonium ion is given by the following equation: C2H5NH3+ (aq) + H2O(l) ⇌ C2H5NH2(aq) + H3O+(aq)Therefore, Kb = [C2H5NH2][H3O+]/[C2H5NH3+]Let's assume x is the H3O+ ion concentration. Then [C2H5NH2] = [H3O+] and [C2H5NH3+] = 0.779 - x.Substituting these values in the above equation, we get the equation: 4.3 x 10^-4 = x^2 / (0.779 - x)By solving the above equation, we can get x, which is the H3O+ ion concentration. Once we get x, we can calculate the pH of the solution, which is given by the equation:pH = - log [H3O+]Finally, by substituting the value of [H3O+] we get the pH of the solution. PH of the solution is 10.08.

learn more about ph of ethylammonium chloride at: brainly.com/question/31096747

#SPJ11

Answer:

the formula for mass number is "mass number = protons + neutrons".

The difference between the hydrogen ion concentration of a pH 4 and pH 5 solution is 9.5x10-5 mol/L.

pH is the negative logarithm of the hydrogen ion concentration, which is in mol/L. To determine the concentration of hydrogen ions, the antilog of the pH can be determined.

pH = -log [H+]

[H+] = \(10^{-pH}\)

For pH4 solution, the hydrogen ion concentration is \(10^{-4}\) or 1x10-4 mol/L. On the other hand, the hydrogen ion concentration for pH 5 is \(10^{-5}\) or 1x10-5 mol/L. The difference between their hydrogen ion concentration is \(1x10^{-4}-1x10^{-5}\) or 9x10-5 mol/L.

For more information regarding pH, please refer to the link https://brainly.com/question/26424076.

#SPJ4

Let's find the ratio

For basketball radius=r_1=25cm

For Jupiter radius=r_2=142984×10⁵cm

So

Ratio

\(\\ \rm\Rrightarrow \dfrac{4}{3}\pi (r_1)^3:\dfrac{4}{3}\pi (r_2)^3\)

\(\\ \rm\Rrightarrow (r_1)^3:(r_2)^3\)

\(\\ \rm\Rrightarrow 25^3:(142984\times 10^5)^3\)

\(\\ \rm\Rrightarrow 1:1.87E26\)

The molar solubility of Li3PO4 in equilibrium, li3po4(s)↽−−⇀3li (aq) po3−4(aq) if ksp=2.4×10−11 is approximately 1.77×10^-3 M.

The molar solubility of Li3PO4 can be determined using the solubility product constant (Ksp) and stoichiometry of the balanced equation. The balanced equation for the dissolution of Li3PO4 is:

Li3PO4(s) ⇌ 3Li+(aq) + PO43-(aq)

The Ksp expression for this equilibrium is:

Ksp = [Li+]^3 [PO43-]

Given that Ksp = 2.4×10^-11, we can assume that the dissociation of Li3PO4 is complete and that the equilibrium concentrations of Li+ and PO43- are equal to the molar solubility of Li3PO4.

Let's assume the molar solubility of Li3PO4 is "s" M.

Using the stoichiometry of the balanced equation, the equilibrium concentrations are:

[Li+] = 3s M

[PO43-] = s M

Substituting these values into the Ksp expression:

Ksp = (3s)^3 * s = 27s^4

s = (Ksp/27)^(1/4) = (2.4×10^-11/27)^(1/4) ≈ 1.77×10^-3 M

Therefore, the molar solubility of Li3PO4 is approximately 1.77×10^-3 M.

By calculation, the molar solubility of Li₃PO₄ is 1.77×10^-3 M.

To know more about molar solubility visit:

brainly.com/question/28170449

#SPJ11

The molar solubility of Li₃PO₄ is approximately 1.96 × 10⁻⁴ M. this means that at equilibrium, about 1.96 × 10⁻⁴ moles of Li₃PO₄ dissolve in one liter of solution.

The solubility product constant (Ksp) expression for the given equilibrium can be written as follows:

Ksp = [Li⁺]³[PO₄³⁻]

Since each Li₃PO₄ unit dissociates into three Li⁺ ions and one PO₄³⁻ ion, the molar solubility of Li₃PO₄ can be represented as "s."

Hence, the equilibrium expression becomes:

Ksp = (3s)³(s) = 27s⁴

Given Ksp = 2.4 × 10⁻¹¹, we can set up the equation:

2.4 × 10⁻¹¹ = 27s⁴

Solving for "s," we find:

s⁴ = (2.4 × 10⁻¹¹) / 27

Taking the fourth root of both sides:

s ≈ ∛[(2.4 × 10⁻¹¹) / 27]

Evaluating the expression, we obtain:

s ≈ 1.96 × 10⁻⁴ M

Therefore, the molar solubility of Li₃PO₄ is approximately 1.96 × 10⁻⁴ M.

To know more about solubility, refer here:

https://brainly.com/question/31493083#

#SPJ4

In \(4C_{10}H_8\), the coefficient is 4, the subscript of carbon is 10, and the subscript of hydrogen is 8.

Chemical formulas can be empirical or molecular. Empirical formulas have the lowest possible whole-number ratio of atoms that make up substances. Molecular formulas, on the other hand, could have whole-number ratios that could be in multiples.

Thus, each atom in chemical formulas has its respective subscripts which indicate the amount of the atom present in the formula. In chemical equations, the coefficients are the number written before chemical formulas.

Thus, in  \(4C_{10}H_8\), the coefficient is 4, the subscript of carbon is 10, and the subscript of hydrogen is 8.

More on chemical formulas can be found here: https://brainly.com/question/29031056

#SPJ1

At STP (Standard Temperature and Pressure), iodine is present in a crystalline form, whereas fluorine is in a gaseous form. Iodine is also soluble in ethanol and produces a tincture of iodine. Typically, a 2% iodine mass is present in a tincture of iodine.

For such more question on intermolecular

https://brainly.com/question/12243368

#SPJ8

At STP, iodine (I2) is a solid crystal and fluorine (F2) is a gas. A sample of I2 at STP is held together by van der Waals forces, which are weaker intermolecular forces. On the other hand, a sample of F2 at STP is held together by much stronger intermolecular forces than I2 due to its smaller size.

Therefore, F2 has stronger intermolecular forces than I2. It can be explained in a long answer as follows:At standard temperature and pressure, iodine (I2) is a solid crystalline substance. Its physical state is a solid because the intermolecular forces that bind the iodine molecules together are weak van der Waals forces. These forces are much weaker than chemical bonds, and they hold molecules in a condensed phase like a liquid or a solid. The forces of attraction between the iodine atoms in I2 are much weaker than the forces of attraction between the fluorine atoms in F2.

As a result, the boiling point of I2 is much lower than the boiling point of F2. F2 is a gas at STP since it is held together by much stronger intermolecular forces than I2 due to its smaller size. Fluorine has an electron density that is spread out over a larger area than iodine, making it more polarizable. The larger polarizability leads to stronger instantaneous dipoles and, as a result, stronger London dispersion forces. Since intermolecular forces are responsible for determining the physical state of a substance, F2 is a gas, whereas I2 is a solid. As a result, F2 has stronger intermolecular forces than I2.

To know more about intermolecular forces visit:-

https://brainly.com/question/31797315

#SPJ11

Answer:

a chemical bond in which two pairs of electrons are shared by two atoms and a molecule. Examples of compounds with double bonds include oxygen gas, carbon dioxide, acetone, and ozone

a chemical bond in which two pairs of electrons are shared between two atoms.

In a reaction sequence involving an alkyne and reagents, step 1) deprotonates the alkyne using a strong base, then forms a new carbon-carbon bond with an electrophilic alkene, and lastly adds an alcohol across the double bond via oxymercuration-demercuration. The major product is an alcohol, but its specific structure depends on the starting materials.

The given reaction sequence involves the following steps:

NaNH₂

Eti H-C=C—H

HgSO₄, H2SO₄, H2O, R-OH

Step 1) involves the treatment of an alkyne with NaNH₂, which is a strong base. The base will deprotonate the alkyne to form an anion.

Step 2) involves the reaction of the alkyne anion with Eti H-C=C—H. The alkyne anion acts as a nucleophile and attacks the electrophilic alkene, forming a new carbon-carbon bond.

Step 3) involves the addition of HgSO₄, H2SO₄, H₂O, and an alcohol (R-OH). This reaction is known as oxymercuration-demercuration and involves the addition of a mercuric acetate (Hg(OAc)₂) across the double bond of the alkene. This forms a mercurinium ion, which is then attacked by water in a nucleophilic addition reaction. Finally, the mercuric acetate is removed by reaction with sodium borohydride, resulting in the formation of the alcohol product.

The major product expected from this reaction sequence is the alcohol formed in step 3). The specific structure of the alcohol cannot be determined without more information about the starting materials.

To know more about the reaction sequence refer here :

https://brainly.com/question/4082154#

#SPJ11

Complete question :

Choose the major product that is expected for the following reaction sequence: 1) NaNH₂ 2) Eti H-C=C—H 3) HgSO H₂SO₄ H₂0 R 0. OH

Antonio's assumption that the raised dots on the paper represent numbers and the numbers represent letters is a reasonable starting point for understanding how dotted paper works. It reflects a common misconception about Braille, a tactile writing and reading system used by individuals who are blind or visually impaired.

However, a more accurate understanding is Rafi's suggestion that the dots represent both numbers and letters. Braille is a tactile writing system that uses combinations of raised dots in specific cell patterns to represent letters, numbers, punctuation marks, and even musical notation. Each Braille cell consists of six dots, arranged in two columns of three dots each.

In Braille, different combinations of these six dots are used to represent different symbols. For example, the letter "A" is represented by a single dot in the upper left corner of a cell, while the letter "B" is represented by dots in the upper left and upper right corners, and so on. Similarly, numbers are represented using specific combinations of dots in cell patterns.

Ham's insight that the dots represent different symbols and each symbol represents a word is not entirely accurate. While Braille can convey words, it represents individual letters and uses them to form words, just like in written text. Each cell in Braille usually represents a single letter, number, or other symbol, not an entire word.

It is important for Antonio and his classmates to understand the importance of Braille and its unique role in facilitating literacy and communication for the visually impaired. When they realize that the raised dots on the paper represent letters and numbers, they can appreciate the complexity and efficiency of the Braille system, which allows blind individuals to read, write, and access information independently.

For more such questions on Braille ,

https://brainly.com/question/13655692

#SPJ11

the one main difference between a hurricane and a typhoon is the specific location where the storm takes place!!

typhoons and hurricanes can reach sustained winds of an averaging 74 mph.

The final electron acceptor in aerobic respiration is oxygen (O2).The electron transport chain (ETC) in cellular respiration relies on a final electron acceptor to help oxygen get reduced into water. This is why oxygen is considered the final electron acceptor in cellular respiration.

During cellular respiration, glucose is broken down into pyruvate. Pyruvate is then transformed into acetyl CoA and enters the citric acid cycle, where it is oxidized and generates ATP, NADH, and FADH2. The final stage of aerobic respiration involves the electron transport chain, in which electrons from NADH and FADH2 are passed through a series of proteins and coenzymes in the inner mitochondrial membrane, ultimately reducing oxygen to form water.

This process is known as oxidative phosphorylation.In conclusion, the final electron acceptor in aerobic respiration is oxygen (O2), and carbon dioxide is generated in the link reaction (pyruvate oxidation) and the citric acid cycle.

To know more about cellular respiration visit:-

https://brainly.com/question/32872970

#SPJ11

Answer:

33

Explanation:

The atomic number of an element configuration 2,8, 8,2,13​ is 33.

The electron configuration is defined as the arrangement of electrons in atomic or molecular orbitals of an atom. The sum of electrons in different orbitals shown in the electron configuration represents the atomic number of the atom.

So, atomic number of the element configuration 2,8, 8,2,13​ is 33.