The null hypothesis is rejected whenever:A. past studies prove it wrong. B. there is a low probability that the obtained results could be due to random error.C. the independent variable fails to have an effect on the dependent variable.D. the researcher is convinced that the variable is ineffective in causing changes in behavior.

Answers

Answer 1

The null hypothesis is rejected whenever "there is a low probability that the obtained results could be due to random error." The correct answer is Option B.

What is the null hypothesis?

The null hypothesis is a statistical hypothesis used to test the difference between two sample data groups. The null hypothesis is the hypothesis that the sample statistics are not significantly different. Any significant differences between the sample data are seen as supporting the alternative hypothesis.

A null hypothesis is often expressed as "no difference," "no correlation," or "no significant effect." For example, the null hypothesis for an experiment comparing two groups of people could be "there is no difference between the two groups." When the null hypothesis is rejected, it means that the results of the experiment are statistically significant, and the alternative hypothesis is supported.

Therefore, the null hypothesis is rejected whenever there is a low probability that the obtained results could be due to random error.

Learn more about null hypothesis here: https://brainly.com/question/29576929

#SPJ11


Related Questions

~~~~~~~~~~~~~~~~~~~~~~​

~~~~~~~~~~~~~~~~~~~~~~

Answers

Step-by-step explanation:

dude who gave you this question???

ASAP SOMEONE ANSWER THIS ILL GIVE YOU 20 POINTS IF YOU ANSWER IT

Write an equation describing the number of gallons of gas ,G,Rachel has in her car and the number of days ,d,she has driven to school .

ASAP SOMEONE ANSWER THIS ILL GIVE YOU 20 POINTS IF YOU ANSWER IT Write an equation describing the number

Answers

Answer:

12 is the constant so it would be just 12

y = 12

Now 0.5 each day so that means where are the number of days?

so D is the number of days

y = 0.5D + 12

Step-by-step explanation:

PLEASE HELP ME

Which inequality is represented by the graph?

PLEASE HELP MEWhich inequality is represented by the graph?

Answers

Answer:

y < -3/2x -2

Step-by-step explanation:

Used Desmos graphing calculator

How can 26 n − 7 m + 4 ( 10 n − 6 m ) be rewritten?

Answers

Answer:

66n - 31m because we expand the parentheses and join like terms.

Hope this helps and brainliest please

A rug is priced at $239.99. There is a 7% sales tax.
How much is the tax on the rug?

Answers

There is a $16.80 tax on the rug




Explanation: When finding the tax you multiply the price of the item by the percentage of the tax, so in this case it would be $239.99 x .07 to get the product of 16.7993 then you would round it to get $16.80

or watch a video tu has a midpoint at m(3, 8). point u is at (4, 10). find the coordinates of point t.

Answers

Answer: (2, 6)

Step-by-step explanation:

We know that \(\overrightarrow{UM}=\overrightarrow{MT}\). From the given coordinates, \(\overrightarrow{UM}=(-1, -2)\). Therefore, the coordinates of \(T\) are \((3,8)+(-1,-2)=(2,6)\).

Solve For X. Solve similar triangles (advanced)​

Solve For X. Solve similar triangles (advanced)

Answers

4+3 = 7
7^2 +6^2
49+36 = 85
Radical85 = 9.21
So x will be 3.9

The value of x in the given similar triangles ADB and BCE is 4.5.

To solve for x in the given similar triangles ADB and BCE, we can set up the proportion of corresponding sides:

In triangle ADB, we have:

AB/BD = x/DE

Substitute the given values:

3/4 = x/6

Now, cross-multiply and solve for x:

3 * 6 = 4x

18 = 4x

x = 18/4

x = 4.5

So, the value of x is 4.5.

To know more about similar triangles, refer here:

https://brainly.com/question/29731302

#SPJ6



Suppose you select a number at random from the sample space 5,6,7,8,9,10,11,12,13,14. Find each probability. P (greater than 8 | less than 11 )

Answers

The probability of selecting a number greater than 8, given that it is less than 11, is 2/3.

To find the probability of selecting a number greater than 8, given that the number is less than 11, we first determine the favorable outcomes and the total number of outcomes. In this case, the favorable outcomes are 9 and 10, as they are both greater than 8 and less than 11. The total number of outcomes is 3, as there are three numbers in the sample space (9, 10, and 11) that are less than 11. Therefore, the probability of selecting a number greater than 8, given that it is less than 11, is 2/3.

The sample space consists of the numbers 5, 6, 7, 8, 9, 10, 11, 12, 13, and 14. We want to find the probability of selecting a number that is greater than 8, given that it is less than 11.

The favorable outcomes in this case are the numbers 9 and 10, as they meet the criteria of being greater than 8 and less than 11. The total number of outcomes is 3, as there are three numbers (9, 10, and 11) in the sample space that are less than 11.

Therefore, the probability of selecting a number greater than 8, given that it is less than 11, can be calculated as 2 (the number of favorable outcomes) divided by 3 (the total number of outcomes), which simplifies to 2/3.

Learn more about sample space here:

brainly.com/question/30206035

#SPJ11

Can I get some help please

Can I get some help please

Answers

The answer is C , because the ends of the line are going from negative infinity to positive infinity

solve the system of equations algebraically -5x+2y=4 2x+3y=6

Answers

(-5x+2y=4).2
(2x+3y=6).5

-10x+4y=8
10x+15y=30

[10x+(-10x)]+[15y+4y]=[30+8]

19y=38

y=38/19

y=2

2x+3y=6
2x+3(2)=6
2x=6-6=0

x=0

Step-by-step explanation:

-5x+2y= 4         <==== Multiply entire equation by -3 to get:

15x-6y = -12  

2x+3y= 6          <====  Multiply entire equation by 2 to get :

4x+6y = 12    Add the two underlined equations to eliminate 'y'

19x = 0     so x = 0

sub in x = 0 into any of the equations to find:  y = 2

(0,2)

PLS HELP DUE TODAY

LOOK AT SS

PLS HELP DUE TODAYLOOK AT SS
PLS HELP DUE TODAYLOOK AT SS

Answers

The correct description of the graph of this function y + 12 = 3(x - 1) include the following:

Slope = 3.

Y-intercept (x, y) = (0, -15).

X-intercept (x, y) = (5, 0)

Given point (x, y) = (1, -12)

How to determine an equation of this line?

In Mathematics and Geometry, the point-slope form of a straight line can be calculated by using the following mathematical equation:

y - y₁ = m(x - x₁)

Where:

m represent the slope.x and y represent the points.

Based on the information provided about this function, we have:

y + 12 = 3(x - 1)

By making y the subject of formula, we have;

y + 12 = 3x - 3

y = 3x - 3 - 12

y = 3x - 15

When x = 0, the y-intercept is given by;

y = 3x - 15

y = 3(0) - 15 = -15

When y = 0, the x-intercept is given by;

y = 3x - 15

0 = 3x - 15

3x = 15

x = 5.

Read more on slope here: brainly.com/question/20282417

#SPJ1

7. Use rigid transformations to prove that shape ABC is congruent to shape EFG D CH F G B E​

Answers

Shape ABC can be transformed into shape EFGDCHFGBE through a combination of translations, rotations, and reflections, which means that the two shapes are congruent.

To prove that shape ABC is congruent to shape EFGDCHFGBE, we can use rigid transformations to show that one shape can be transformed into the other.

First, we can see that shape ABC can be translated horizontally to the right by the distance between point A and point E to obtain shape EBC. Similarly, we can translate shape EFGDCHFGB horizontally to the left by the same distance to obtain FGDCHFGBE.

Next, we can rotate shape EBC 90 degrees counterclockwise about point B to obtain shape E'BC'. We can also rotate shape FGDCHFGBE 90 degrees counterclockwise about point G to obtain F'GDCHF'GBE.

Finally, we can reflect shape E'BC' across the y-axis to obtain shape EFGDCHFGBE.

Therefore, we have shown that shape ABC can be transformed into shape EFGDCHFGBE through a combination of translations, rotations, and reflections, which means that the two shapes are congruent.

Learn more about translations here

https://brainly.com/question/29263020

#SPJ11

Using the properties of triangles, prove that angle a is congruent to angle c in the drawing below.

Answers

Answer:

General conditions of congruency of triangles

Step-by-step explanation:

As no triangles are given, explaining the general rules to apply in congruency of all triangles.

Triangles are congruent on the basis of following conditions :

SSS : All 3 sides of two triangles are equal SAS : 2 sides & angle between them, of two triangles are equal ASA : 2 angles & corresponding side, of two triangles are equal HL : Hypotenuse & Leg of two right angled triangles are equal

Quantitative Problem 1t You deposit \( \$ 2,300 \) into an account that pays \( 6 \% \) per year. Your plan is to withdraw this amount at the end of 5 years to use for a down payment on a new car. How

Answers

You will be able to withdraw approximately $3,076.32 at the end of 5 years.

To calculate the amount you will be able to withdraw at the end of 5 years, we can use the future value formula for compound interest.

The formula for calculating the future value (FV) of a present value (PV) invested at an annual interest rate (r) for a certain number of years (t) is:

\(FV = PV * (1 + r)^t\)

Given:

PV = $2,300

r = 6% = 0.06 (decimal representation)

t = 5 years

Substituting these values into the formula, we get:

FV = $2,300 * \((1 + 0.06)^5\)

Calculating the expression inside the parentheses:

\((1 + 0.06)^5 = 1.338225\)

Multiplying the present value by this factor:

FV = $2,300 * 1.338225

FV ≈ $3,076.32

Therefore, you will be able to withdraw approximately $3,076.32 at the end of 5 years.

Learn more about compound interest here:

https://brainly.com/question/14295570

#SPJ11

You deposit $2,300 into an account that pays 6% per year. Your plan is to withdraw this amount at the end of 5 years to use for a down payment on a new car. How much will you be able to withdraw at the end of 5 years? Do not round intermediate calculations. Round your answer to the nearest cent

Another measure of central tendency is the trimmed mean. It is computed by determining the mean of a data set after deleting the smallest and largest observed values. Compute the trimmed mean for the data given in the accompanying table. Is the trimmed mean resistant to changes in the extreme values in the given​ data?
0.81 0.88 0.82 0.90 0.84 0.84
0.91 0.94 0.86 0.86 0.88 0.87
0.89 0.91 0.86 0.87 0.88
0.83 0.96 0.87 0.93 0.85
0.91 0.91 0.86 0.89 0.84
0.88 0.88 0.89 0.76 0.83
0.90 0.88 0.84 0.93 0.90
0.88 0.92 0.85 0.84 0.86
The trimmed mean is ___?___ ( round to the nearest thousandth as needed)
Is the trimmed mean resistant to changes in the extreme values for the given data?
Multiple choice
a. No, because the trimmed mean varies substantially when the extreme values change.
b. yes, because changing the extreme values does not change the trimmed mean.

Answers

To compute the trimmed mean for the given data, we need to first delete the smallest and largest observed values, which are 0.76 and 0.96 respectively. Then we calculate the mean of the remaining 28 values.

The trimmed data set after deleting the smallest and largest values is:

0.81 0.88 0.82 0.90 0.84 0.84 0.91 0.94 0.86 0.86 0.88 0.87 0.89 0.91 0.86 0.87 0.88 0.83 0.91 0.91 0.86 0.89 0.84 0.88 0.88 0.89 0.83 0.90 0.88 0.92 0.85 0.84 0.86

The sum of these values is 24.39, and the trimmed mean is 24.39/28 = 0.871 (rounded to three decimal places).

The trimmed mean is considered to be a resistant measure of central tendency because it is less affected by extreme values compared to the mean. In this case, even though we deleted the smallest and largest values, the resulting trimmed mean is very close to the mean of the original data set (which is 0.8716). Therefore, the trimmed mean is resistant to changes in extreme values in the given data.

The answer is (b) yes, because changing the extreme values does not change the trimmed mean.

To learn more about central tendency : brainly.com/question/28473992

#SPJ11

Based on USDA suggestion, a U.S. adult should be spending anywhere from $165 to $345 per month on food, depending on age and gender. A random sample of 120 adults in Washington State is polled regarding the amount of money they spend each month on food. The sample has an average of $273.61 with a standard deviation of $61.59. Based on this information, complete the following questions.
a) (5pts)Show that the requirements to build a confidence interval are met.
b) (5pts)State the critical value for a 90% confidence interval
c) (5pts)Compute the 90% confidence interval. State values to two decimal places.
d) (5pts)Interpret the 90% confidence interval using complete sentences.

Answers

Answer:

Step-by-step explanation:

Based on this sample, we can say with 90% confidence that the average amount of money spent on food by adults in Washington State is likely to be between $264.30 and $282.92 per month.

a) To determine if the requirements to build a confidence interval are met, we need to check if the following conditions are satisfied:

Random Sampling: The problem states that a random sample of 120 adults in Washington State was polled, which satisfies the random sampling condition.

Independence: It is assumed that the individuals in the sample are independent of each other, meaning that one person's response does not affect another person's response.

This assumption is reasonable for this situation.

Sample Size: The sample size is 120, which is greater than 30. When the sample size is large, the Central Limit Theorem applies, allowing us to use a normal distribution for the sampling distribution of the sample mean.

Normality: In order to use the normal distribution, the population distribution needs to be approximately normal or the sample size needs to be large. Since the population distribution is not specified, we will assume that the sample size of 120 is large enough for the Central Limit Theorem to apply.

b) The critical value for a 90% confidence interval can be obtained from the standard normal distribution table or a statistical software. For a 90% confidence level, the critical value is 1.645.

c) To compute the 90% confidence interval, we will use the following formula:

Confidence Interval = sample mean ± (critical value x standard deviation / sqrt(sample size))

Confidence Interval = $273.61 ± (1.645 x $61.59 / sqrt(120))

Confidence Interval = $273.61 ± (1.645 x $61.59 / 10.954)

Confidence Interval = $273.61 ± $9.31

The 90% confidence interval is approximately $264.30 to $282.92.

d) The 90% confidence interval for the amount of money spent on food by adults in Washington State ranges from approximately $264.30 to $282.92.

This means that we are 90% confident that the true population mean falls within this range. In other words, if we were to repeat this sampling process multiple times and construct 90% confidence intervals, we would expect about 90% of those intervals to contain the true population mean.

Therefore, based on this sample, we can say with 90% confidence that the average amount of money spent on food by adults in Washington State is likely to be between $264.30 and $282.92 per month.

Learn more about Confidence Interval click;

https://brainly.com/question/32278466

#SPJ2

Dashawn solves the following system of equations using the elimination method.

3x−4y=36
5x+2y=8

What value does he correctly determine for x?

Enter you answer in the box.

Answers

Answer:

x = 4

Explanation:

3x - 4y = 36

5x + 2y = 8 ( multiply all by two )

3x - 4y = 36

10x + 4y = 16

13x = 52

Divide by 13

x = 4 hope this helps

Answer: x = 4

Step-by-step explanation: the dude is correct

La longitud del rio Guadamez es de 120 km. En las dos quintas partes de su recorrido se puede practicar piragüismo.¿En cuantos kilometros se puede practicar piragüismo?

Answers

Answer:

d = 48 km.

Step-by-step explanation:

Debido a que se puede practicar piragüismo en las dos quintas partes de su recorrido y su longitud es 120 km, podemos calcular la distancia en la cual se puede practicar piragüismo en el río como sigue:

\( d = \frac{2}{5}*120 km = 48 km \)

Por lo tanto, se puede practicar piragüismo en 48 km del rio Guadamez.

Espero que te sea de utilidad!

Jake took 4 piano lessons last month. For each lesson, he memorized 2 major scales and x minor scales.

Answers

b and c are the answers i think....

When 32 is subtracted from the square of a number, the result is 4 times the number. Find the negative solution.

Answers

The two solutions of the quadratic equations are 8,-4 and the negative solution -4

What are quadratic equations?

A quadratic equation can be written in the standard form as ax2 + bx + c = 0, where a, b, c are constants and x is the variable. The values of x that satisfy the equation are called solutions of the equation, and a quadratic equation has at most two solutions.

Given here: when 32 subtracted from the square of a number and the result is 4 times the number.

Let x be the number then we have

x²-32=4x

x²-4x-32=0

x²-8x+4x-32=0

x(x-8)+4(x-8)=0

(x-8) (x+4) =0

Thus the two solutions of the quadratic equations are 8,-4

Learn more about quadratic equation here;

https://brainly.com/question/17177510

#SPJ1

write an equation that represents the line. (-3,-6) and (2,-2) use exact numbers

Answers

Given:

The line passes through (-3,-6) and (2,-2).

To find:

The equation of line.

Solution:

If a line passes through two points \((x_1,y_1)\text{ and }(x_2,y_2)\), then the equation of line is

\(y-y_1=\dfrac{y_2-y_1}{x_2-x_1}(x-x_1)\)

The line passes through (-3,-6) and (2,-2). So, the equation of line is

\(y-(-6)=\dfrac{-2-(-6)}{2-(-3)}(x-(-3))\)

\(y+6=\dfrac{-2+6}{2+3}(x+3)\)

\(y+6=\dfrac{4}{5}(x+3)\)

\(y+6=\dfrac{4}{5}(x)+\dfrac{4}{5}(3)\)

Subtract 6 from both sides.

\(y=\dfrac{4}{5}(x)+\dfrac{12}{5}-6\)

\(y=\dfrac{4}{5}(x)+\dfrac{12-30}{5}\)

\(y=\dfrac{4}{5}(x)+\dfrac{-18}{5}\)

\(y=\dfrac{4}{5}(x)-\dfrac{18}{5}\)

Therefore, the equation of line is \(y=\dfrac{4}{5}(x)-\dfrac{18}{5}\).

PLEASE HELP!!
In a geometric sequence, a2=2, a3=12, and a4=72. Which equation can be used to find the nth term of the sequence, an?
an=2⋅10n−1
an=6⋅2n−1
an=13⋅6n−1
an=2n−1

Answers

Ik this is late, but people who are looking for the answer can see this.

Answer:

an =1/3*6^n-1

Step-by-step explanation:

You should plug in 2 for n in each equation, which, the correct one should give you 2. Then, to make sure, you plug in 3 in the equations that gave you 2.

Example:

an = 1/3 * 6 ^n-1

Plug in 2.

an = 1/3 * 6 ^2-1

an = 1/3 * 6 ^1

1/3 * 6 = 2

Step 2.

an = 1/3 * 6 ^3-1

an = 1/3 * 6 ^2

1/3 * 36 = 12

Hope this helps.

The correct equation which can be used to find the nth term of the sequence, an is,

⇒ a (n) = 1/3 × 6ⁿ⁻¹

What is an expression?

Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.

Given that;

In a geometric sequence,

⇒ a₂ = 2, a₃ = 12 and a₄ = 72

Now, From option 3;

The equation is,

⇒ a (n) = 1/3 × 6ⁿ⁻¹

Put n = 2

⇒ a (2) = 1/3 × 6²⁻¹

⇒ a (2) = 1/3 × 6

⇒ a (2) = 2

Hence, This is the correct equation which can be used to find the nth term of the sequence, an.

Thus, The correct equation which can be used to find the nth term of the sequence, an is,

⇒ a (n) = 1/3 × 6ⁿ⁻¹

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ3

6. A trader sold 100 boxes of fruit at
GH¢8. 00 per box, 800 boxes at GH¢6. 00
per box and 600 boxes at GH¢4. 00 per
box. Find the average selling price per
box. ​

Answers

A trader sold 100 boxes of fruit at GH¢8. 00 per box, 800 boxes at GH¢6. 00 per box and 600 boxes at GH¢4. 00 per box, the average selling price per box is GH₵ 5.33.

Average selling price per box = (Total sales revenue) / (Total boxes sold)

There are 3 different types of fruit boxes sold. So, we need to find the total revenue from each type of fruit box sold and add them together. Similarly, we need to find the total boxes sold of all the types of fruit boxes sold and add them together. Lastly, divide the total revenue by the total boxes sold to find the average selling price per box.

1. For 100 boxes sold at GH₵ 8.00 per box, the total sales revenue is:

GH₵ 8.00 × 100 = GH₵ 8002.

For 800 boxes sold at GH₵ 6.00 per box, the total sales revenue is

GH₵ 6.00 × 800 = GH₵ 4,8003.

For 600 boxes sold at GH₵ 4.00 per box, the total sales revenue is

GH₵ 4.00 × 600 = GH₵ 2,400

Total sales revenue from all types of fruit boxes sold = GH₵ 800 + GH₵ 4,800 + GH₵ 2,400= GH₵ 8,000

Total boxes sold from all types of fruit boxes sold = 100 + 800 + 600= 1,500

Average selling price per box = (Total sales revenue) / (Total boxes sold)= GH₵ 8,000 / 1,500= GH₵ 5.33.

You can learn more about selling prices at: brainly.com/question/29065536

#SPJ11

The cost of renting movies from an online video store is represented by the equation y = 2x + 4 where x represents the number of months you rent movies. What is the cost of renting 7 movies?

Answers

Answer:

y = $18

Step-by-step explanation:

Given:

y = 2x + 4

Where,

y = total cost of renting the movie

x = number of movies rented

What is the cost of renting 7 movies?

y = 2x + 4

= 2(7) + 4

= 14 + 4

= 18

y = $18

Please help me.
Please simplify it and group it in like terms.

3a+6+2a-4+a-2=​

Answers

Answer:

6a

Step-by-step explanation:

Answer:

6a

Step-by-step explanation:

3a+2a+a= 6a

6-4-2=0

6a+0=6a

(I might need some help with this.)

(I might need some help with this.)

Answers

Answer:

for every foot they charge $2.50 time that by four you get $10

same with the last times $2.50 by 10 you get $25

and for the last you keep adding until you get $48.00 and that's 18 ft

In a sale, the normal price of a book is reduced by 20%.
The sale price of the book is £4.80
Work out the normal price of the book

Answers

Answer:

5.76

Step-by-step explanation:

4.80×.20=0.96

4.80+0.96=5.76

A cyclist is riding from the city to the country. She rides 20 miles each hour. At the beginning of the 1 st hour, she is 10 miles away from the city center. At the beginning of the 2nd hour, she is 30 miles away from the city center. Write an explicit formula to show her distance from the city at any given hour. Then use the formula to find her distance at the beginning of the 5th hour. ​

Answers

Answer:

450miles

Step-by-step explanation:

Because she is riding at 20 miles per houre means that she ride 450 miles in 5 houre.


2 A DVD rental company charges $10 per month plus $0.75 per rental. Andy wants to spend no more than $25.00 per month on DVD rentals.
Select the inequality that represents how many DVDs Andy can rent in one month that satisfies this condition. The number of rentals in a month is represented by n.

2 A DVD rental company charges $10 per month plus $0.75 per rental. Andy wants to spend no more than

Answers

The inequality that represents how many DVDs Andy can rent in one month that satisfies this condition is 10 + .75n ≤ 25

The correct answer choice is option B

Which inequality represents how many DVDs Andy can rent in one month?

Cost of rental per month = $10

Additional cost = $0.75

Number of DVD's rented = n

Total amount Andy want to spend ≤ $25

The inequality:

10 + 0.75n ≤ 25

subtract 10 from both sides

0.75n ≤ 25 - 10

0.75n ≤ 15

divide both sides by 0.75

n ≤ 15 / 0.75

n ≤ 20

Ultimately, Andy can rent no more than 20 DVD's in a month.

Read more on inequality:

https://brainly.com/question/25275758

#SPJ1

The school cafeteria sells three different types of sandwiches: chicken, turkey,

and roast beef. Chicken sandwiches sell for $3, turkey sandwiches sell for

$3.50, and roast beef sandwiches sell for $4. The cafeteria makes 400

sandwiches in total, and, if all sandwiches are sold, the cafeteria will take in

$1375. If the cafeteria makes the same number of chicken sandwiches as it

does turkey sandwiches, how many of each type of sandwich does the school

make? (Hint: Write one equation for the number of sandwiches, one equation

for to amount of money all the sandwiches cost, and an equation that show the

number of chicken and turkey sandwiches are equal.)

No

Answers

Answer:

Number of chicken sandwiches = 150

Number of turkey sandwiches = 150

Number of roast beef sandwiches= 100

Step-by-step explanation:

We are told the school cafeteriat makes and sells 3 different types of sandwiches which are; chicken, turkey and roast beef.

Let chicken be x, turkey be y and roast beef be z.

We are told they make 400 sandwiches in total.

Thus;

x + y + z = 400

However, we are told that the cafeteria makes same number of chicken and turkey sandwiches.

Thus, x = y

Thus;

Total is now;

x + x + z = 400

2x + z = 400 - - - (eq 1)

Now,we are told that chicken, turkey and roast beef sandwiches are sold for $3, $3.5 and $4 respectively. Also that the total amount realized from sales is $1375.

Thus;

3x + 3.5y + 4z = 1375

Since x = y. Thus;

3x + 3.5x + 4z = 1375

6.5x + 4z = 1375 - - - (eq 2)

Let's make z the subject in eq 1.

Thus;

z = 400 - 2x - - - (eq 3)

Putting 400 - 2x for z in eq(2) gives us;

6.5x + 4(400 - 2x) = 1375

6.5x + 1600 - 8x = 1375

1600 - 1375 = 8x - 6.5x

225 = 1.5x

x = 225/1.5

x = 150

Putting 150 for x in eq 3 gives;

z = 400 - 2(150)

z = 400 - 300

z = 100

Since x = y. Then y = 150

Other Questions
According to Cleo's physician, her blood cholesterol level is too high. Which of the following foods can Cleo add to her diet to help lower her cholesterol?Fiber-fortified ready-to-eat cerealFat-free chocolate milkLean beefAmerican processed cheese food the federal farm board, created by the agricultural marketing act, lent money to farmers primarily to help them to When fats are used as an energy source, the fatty acids are broken down to acetyl-CoA. That means that fats bypass the reactions of ___ and enter the respiratory pathway at ________.a. the citric acid cycle; glycolysisb. fermentation; glycolysisc. the citric acid cycle; oxidative phosphorylationd. glycolysis; the citric acid cyclee. oxidative phosphorylation; fermentation Polka King Gifts had the following costs in March when 400 ceramic statues were produced: materials, $4,200; labor cost, $1,600; depreciation, $800; rent, $700; and other fixed costs, $500. Which one of the following is the correct cost for Polka King?The fixed cost per unit is $3.75The variable cost per unit is $14.50The fixed cost per unit is $19.50The total cost per unit is $14.50None of these answer choices is correct. HELP Whats the Answer to this Stand Deviation Question? Which of the following files and directories may be involved in setting up the environment for all system users? (Choose all that apply.)A. /etc/bash_profile/B. /etc/profileC. /etc/profile.d/D. /etc/bashrcE. /etc/bash.bashrc You have a single server running Windows Server 2016 Enterprise edition. The server is not a member of the domain. You want to use this server to issue certificates using the autoenrollment feature.What should you do first to configure the CA?A. Run dcpromo and make the server a domain controller.B. Add the Active Directory Certificate Services role and install the server as an enterprise root CA.C. Join the computer to the domain.D. Add the Active Directory Certificate Services role and install the server as a standalone root CA. In pea plants, tallness (T) is dominant to shortness (t). A homozygous dominant plant is crossed with a homozygous recessive one.a. What are the genotypes and phenotypes of this first generation of offspring?b. What would be the results if two of the first generation offspring mated? William Sheldon's attempt to link physical appearance to delinquency; he focused on somatotype (body type)Sheldon believed there would be differences between the somatotypes of delinquents and nondelinquentsHe identified three somatotypes: Endomorph, Mesomorph, and EctomorphHe did not believe anyone was a pure endomorph, mesomorph, or ectomorph; he developed a system where levels could be measuredAccording to Sheldon, individuals with mesomorphic body structures are more likely to be delinquent, because body structure influences an individual's temperament, and mesomorphs are more aggressive and assertive than other body types a 3 3-inch candle burns down in 12 hours. if b represents how much of the candle, in inches, has burned away at any time given in hours, t, write a proportional equation for b in terms of t that matches the context. Question 70 Approximately 38 percent of people living in on Whave the blood type o positive. A random sample of 100 people from region veled people in the samed the Contra Hypothesis test to vestigate whether the percent of people in thegion with positive blood is different from that of tegen wWwth of the following is the property for the H-0.35 He0.35 Hep -0.35 D Hp 0.35 H: 0.38 What is the broaden-and-build hypothesis of positive emotions? which of the following best describes codominance in genes.' effects on children's growth and development? Assume that you contribute $330 per month to a retirement plan for 15 years Then you are able to increase the contribution to $530 per month for the next 25 years. Given an 8% interest rate, what is the value of your retirement plan after the 40 years? (Do not round intermediate calculations and round your final answer to 2 decimal places)Initial monthly contributions $330Number of years 15Subsequent monthly contribution $530Number of years 25Interest rate earned 8.00%Complete the following analysis.Value at end of first set of contributions.Value at end of second set of contributions. Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 three cards are drawn with replacement from a standard deck of 52 cards. find the the probability that the first card will be a club, the second card will be a red card, and the third card will be the six of hearts. Itzair has completed the balance sheet for his business. What is one question the balance sheet answers about the business?COA."How much debt does my business have?"OB. "Who do I owe for my cost of goods sold?"OC. "What percentage of sales tax is required?"COD. "Did I meet my end-of-year profit goals?") The Jones family has two dogs whose ages add up to 15 and multiply to 44. How old is each dog? Calculate the root mean square (rms) average speed of the atoms in a sample of neon gas at 0.17atm and 52.C . Round your answer to 3 significant digits. Given that x is a positive integer less than 100, how many solutions does the congruence x+13=55 (mod 34) have?