When an ionic compound is created, energy is _________when creating the cation, energy is usually _______ when creating the anion, and energy is _______ when the ionic bond is formed resulting in a net [ Select ] of energy for the entire process of making an ionic compound.

Answer:

Explanation:

We know that momentum is the product of mass and velocity so here

mass (m) = 1700 kg

velocity (v) = 13 m/s

So now

momentum = m * v

                   = 1700 * 13

                   = 22100 kg m/s

hope it helps :)

Molar concentration of Zn2+ions in a solution is 3.481 mol/lit

The electrode potential value is 59mV

Temperature=298k

What is electrode potential?

equation formed- Zn → Zn2+ + 2e

              from Nernst equation-

E=E cell - 0.059 log [Zn2+]

[zn2+]=3.481 mol/lit

hence, Molar concentration of Zn2+ions in a solution is 3.481 mol/lit

Learn more about electrode potential here:

https://brainly.com/question/15417662

#SPJ10

Answer:its saturated   or  unsaturaded

Explanation:

There are approximately 3.47 x 10²² molecules in 5.657g H₂SO₄.

To calculate the number of molecules in 5.657g H₂SO₄, we need to use the Avogadro's number and the molar mass of H₂SO₄.

The molar mass of H₂SO₄ is 98.079 g/mol.

We need to calculate the number of moles of H₂SO₄:

Number of moles = mass/molar mass

                             = 5.657g / 98.079 g/mol

                            = 0.05767 mol.

Then, we can use Avogadro's number, which is 6.022 x 10²³ molecules/mol, to find the number of molecules:

Number of molecules = number of moles x Avogadro's number

                                   = 0.05767 mol x 6.022 x 10²³ molecules/mol

                                    = 3.47 x 10²² molecules

To calculate the number of molecules in a given sample of a substance, you need to use the Avogadro's number, which is 6.022 x 10²³ molecules/mol. This means that one mole of a substance contains 6.022 x 10²³ molecules.

We are given the mass of H₂SO₄, which is 5.657 g. To calculate the number of molecules, we first need to determine the number of moles of H₂SO₄ in the given sample. The molar mass of H₂SO₄ is 98.08 g/mol. So, the number of moles of H₂SO₄ can be calculated as follows:

moles = mass / molar mass

moles = 5.657 g / 98.08 g/mol

moles = 0.0576 mol

Now, we can use the Avogadro's number to determine the number of molecules of H₂SO₄ in 0.0576 moles:

number of molecules = moles x Avogadro's number

number of molecules = 0.0576 mol x 6.022 x 10²³ molecules/mol

number of molecules = 3.47 x 10²² molecules

As a result, in 5.657 g of the material, there are roughly 3.47 x 1022 molecules of H₂SO₄.

To know more about the Molecules, here

https://brainly.com/question/11488454

#SPJ1

Answer:

0.51

Explanation:

Given the Nernst equation;

E= E° - 0.0592/n logQ

E= 355 mV or 0.355 V

E° = 0.34 - 0= 0.34 V

n= 2(two electrons were transferred in the process)

Equation of the reaction;

H2(g) + Cu^2+(aq) -----> 2H^+(aq) + Cu(s)

Substituting values;

0.355 = 0.34 - 0.0592/2 log([H^+]/1)

0.355 - 0.34 = - 0.0296 log [H^+]

0.015/-0.0296 = log [H^+]

Antilog (-0.5068) = [H^+]

[H^+] = 0.311 M

pH = -log[H^+]

pH= - log(0.311 M)

pH = 0.51

The potential difference between the half cell of the electrochemical cell is called cell potential. The pH of the solution at 355 mV will be 0.51.

An electrochemical cell generates electricity from the redox chemical reactions occurring inside the cell.

The balanced chemical reaction is shown as,

\(\rm H_{2}(g) + Cu^{2+}(aq) \rightarrow 2H^{+}(aq) + Cu(s)\)

Using the Nernst equation:

\(\rm E= E^{\circ} - \dfrac{0.0592}{n }logQ\)

Given,

E = 0.355 V

E° = 0.34 V

n = 2

Substituting values in the above equation:

\(\begin{aligned} 0.355 &= 0.34 - \dfrac{0.0592}{2} \;\rm log(\dfrac{[H^{+}]}{1})\\\\0.355 - 0.34 &= - 0.0296 \rm \; log [H^{+}]\\\\\dfrac{0.015}{-0.0296} &= \rm \; log [H^{+}]\end{aligned}\)

Solving further,

\(\begin{aligned} \rm Antilog (-0.5068)& = \rm [H^{+}]\\\\\rm [H^{+}] &= 0.311 \;\rm M \end{aligned}\)

The pH of the solution is calculated as:

\(\begin{aligned} \rm pH &= \rm -log[H^{+}]\\\\&= \rm - log(0.311\; M)\\\\&= 0.51\end{aligned}\)

Therefore, 0.51 is the pH of the solution.

Learn more about pH here:

https://brainly.com/question/9207631

Answer:

\(M_{CO_2}=0.01665M\)

Explanation:

Hello,

In this case, the Henry's law allows us to relate the molar concentration and partial pressure of a solute (carbon dioxide) in a solution (solvent is water) by:

\(M_{CO_2}=H_{CO_2}p_{CO_2}\)

Whereas we introduce the Henry constant, therefore, we can easily compute the molar solubility by:

\(M_{CO_2}=p_{CO_2}*H_{CO_2} =0.45atm*3.7x10^{-2}\frac{M}{atm}\\\\M_{CO_2}=0.01665M\)

Regards.

Answer:

(C) NO2 has covalent bonds.

Answer:

Following are the responses to the given question:

Explanation:

They told everyone to "think of the source of energy which perfectly responds to needs of society." It's why I would like to point out though those dynamos could be used to generate electricity using rotating cycles which can be used in gyms. The above conduits are indeed very regular used in this gym and could be the cheapest, ecologically responsible, highly reliable because it contributes to international access, is really very stable and can probably not cause damage, as well as the provision, can also be very large if we can create it.

Answer:

Bar Graphs

Explanation:

Answer: Scatterplot

Explanation:

The rate constant for the reaction is either 7.14×10−3 s−1 or 2.50×10−3 s−1, depending on which rate was used to calculate it.

The rate of the reaction is given by the equation:

Rate = -k[A]

where k is the rate constant and [A] is the concentration of the reactant.

Rate at t=140 s:

Rate = (8.00×10−2 M - 0 M) / (140 s - 0 s)

= 5.71×10−4 M/s

Rate at t=400 s:

Rate = (4.00×10−2 M - 0 M) / (400 s - 0 s)

= 1.00×10−4 M/s

Since this is a zero-order reaction, the rate of the reaction is constant, and we can use either rate to calculate the rate constant:

k = Rate / [A]

Using the rate at t=140 s:

k = 5.71×10−4 M/s / 8.00×10−2 M = 7.14×10−3 s−1

Using the rate at t=400 s:

k = 1.00×10−4 M/s / 4.00×10−2 M

= 2.50×10−3 s−1

The rate constant for the reaction is either 7.14×10−3 s−1 or 2.50×10−3 s−1.

Learn more on zero-order reaction https://brainly.com/question/21663229

#SPJ1

Answer:

D) 4.08

Explanation:

HC3H5O3, [HA]: 0.04L * 0.5M = 0.24L(M2)

M2 = 0.083M

C3H5O3-, [A-]: 1.0L * 0.2L = 0.24L (M2)

M2 = 0.83M

Use the Henderson-Hasselbalch equation:

log(0.83/0.083) = 1

Therefore pH = 3.08 + 1 = 4.08

Option c is the correct response since the original concentration of Cu+2 is 2*0.019 M = 0.038 M after mixing the 5 ml unknown material with the 5 ml NH3 solution.

The amount of solute in a certain volume of solution is how concentrated a material is. Concentrations are expressed in terms of molarity, or the amount of solute per liter of solution.

the condition of being focused: the act or activity of focusing. more specifically: focusing on a particular thing. My attention is being disrupted by all that noise. : a major or region of concentration within a major.

To know more about concentration visit:

https://brainly.com/question/10725862

#SPJ1

Answer:

B. Cu + AgNO3 → CuNO3 + Ag

C. 2NaBr + Cl2 → 2NaCl + Br2

D. F2 + 2NaBr → 2NaF + Br2

Explanation:

There are several types of reactions in chemistry, of which one of them is the SINGLE DISPLACEMENT REACTION. Single displacement reaction is that reaction in which only one element in a compound is displaced/replaced by another element.

The following reactions given in this question are examples of single displacement reactions;

- Cu + AgNO3 → CuNO3 + Ag

- 2NaBr + Cl2 → 2NaCl + Br2

- F2 + 2NaBr → 2NaF + Br2

* In the first reaction, silver (Ag) is displaced by copper (Cu)

* In the second reaction, bromine (Br) is displaced by chlorine (Cl)

* In the third reaction, bromine (Br) is displaced by fluorine (F)

The single replacement reaction are;

A single displacement reaction is one in which one of the reactants replaces another. A typical example is the reaction; A + BC ---> AB + C.

Having this in mind, we can see that the reactions that correspond to a single replacement reaction are;

Learn more about single replacement reaction: https://brainly.com/question/1984022

If a reaction has a negative ΔG and a positive ΔS, the reaction will be spontaneous at all temperatures.

If a reaction is spontaneous at all temperatures, it implies that the reaction will occur without the need for any external intervention, such as the addition of energy. For a reaction to be spontaneous, it must satisfy the criteria of thermodynamic favorability, which is determined by the change in Gibbs free energy (ΔG) associated with the reaction.

The relationship between ΔG, temperature (T), and the equilibrium constant (K) of a reaction is described by the equation ΔG = ΔH - TΔS, where ΔH is the change in enthalpy and ΔS is the change in entropy.

To ensure spontaneity at all temperatures, two conditions must be met:

ΔG must be negative: A negative ΔG indicates a thermodynamically favorable reaction, meaning the products have a lower Gibbs free energy than the reactants. If ΔG is negative, the reaction will proceed spontaneously in the forward direction.

ΔS must be positive: A positive ΔS signifies an increase in the overall entropy of the system. Higher entropy means more disorder, and spontaneous reactions often involve an increase in randomness. When ΔS is positive, it can compensate for the enthalpic term, ΔH, allowing the reaction to proceed spontaneously.

For more such questions on spontaneous  visit:

https://brainly.com/question/30127476

#SPJ8

The volume of oxygen gas produced by the decomposition of 3.05 g KCIO₃ according to the given equation is 1.68 liters

Let us begin by obtaining the mole of 3.05 g of KClO₃. Details below:

Mole = mass / molar mass

Mole of KClO₃ = 3.05 / 122.5

Mole of KClO₃ = 0.025 mole

Next, we shall determine the mole of of oxygen gas, O₂ produced from the reaction. Details below:

KClO₃ -> 2KCl + 3O₂

From the balanced equation above,

1 mole of KClO₃ reacted to produced 3 moles of O₂

Therefore,

0.025 mole of KClO₃ will react to produce = 0.025 × 3 = 0.075 mole of O₂

Finally, we shall obtain the volume of oxygen gas, O₂ produced. This is shown below

At STP,

1 mole of O₂ = 22.4 Liters

Therefore,

0.075 moles of O₂ = 0.075 × 22.4

0.075 moles of O₂ = 1.68 liters

Thus, the volume of oxygen gas, O₂ produced is 1.68 liters

Learn more about volume:

https://brainly.com/question/225322

#SPJ1

55.03 moles of KCI are produced when 6743 grams of \(KClO_{3}\) decomposes

To determine the number of moles of KCl produced when 6743 grams of \(KClO_{3}\) decomposes, we need to use the concept of molar mass and the balanced chemical equation.

First, let's calculate the molar mass of \(KClO_{3}\)

The molar mass of potassium (K) is approximately 39.10 g/mol.

The molar mass of chlorine (Cl) is approximately 35.45 g/mol.

The molar mass of oxygen (O) is approximately 16.00 g/mol.

So, the molar mass of \(KClO_{3}\) is:

(39.10 g/mol) + (35.45 g/mol) + (3 * 16.00 g/mol) = 122.55 g/mol.

Now, we need to calculate the number of moles of \(KClO_{3}\):

Number of moles = Mass / Molar mass

Number of moles = 6743 g / 122.55 g/mol = 55.03 mol.

According to the balanced chemical equation:

2\(KClO_{3}\) -> 2 KCl + 3 O2,

we can see that for every 2 moles of \(KClO_{3}\), we obtain 2 moles of KCl.

Therefore, the number of moles of KCl produced will be equal to the number of moles of \(KClO_{3}\) since the ratio is 1:1. Thus, 55.03 moles of KCl will be produced.

Know more about molar mass here:

https://brainly.com/question/837939

#SPJ11

This problem is providing information about the states of matter and a given diagram showing a molecular arrangement it has. Thus, we can start off by analyzing the attached file, which shows molecular arrangements and movements each state exhibits.

Solids are quite organized so that they are able to form molecular networks in which molecules vibrate but do not displace anywhere. Liquid molecules are close enough to have small movements and vibrations but are not able to form any organized network.

Gases, however, exhibit no molecular organization but large movements inside the container whose walls the gas constantly crash against. Plasma do not have any order neither yet it contains ions.

In such a way, since the given diagram do not have any apparent order or ion, we infer this is about a gas that moves into the container and crash against its walls.

Learn more:

1. A mixture of ammonium chloride, sand, and zinc chloride should be separated by sublimation.

2. A mixture of zinc chloride and silver chloride should be separated through crystallization.

A separation technique can be defined as a technique that is typically used to separate or convert two (2) or more mixture and solution of chemical substances into distinct product such as chemical compounds or elements.

In Chemistry, there are various types of separation technique used for the separation of mixtures or solutions and these include:

In this scenario, the most effective and efficient means to separate a mixture of ammonium chloride, sand, and zinc chloride is by sublimation from solid to gas state.

On the other hand, the best means to separate a mixture of zinc chloride and silver chloride is through crystallization.

Read more on crystallization here: https://brainly.com/question/4980962

Answer:

9.) Homeostasis

10.) Epidermis

11.) Cytoplasim

12.) Classification

To draw a heating curve include the temperatures in the observation as well as state changes (solid-liquid-gas)

A heating curve is a type of graph that shows how substances change when exposed to constant heat. This often includes not only a change in temperature but also changes in the state.

Moreover, if a change in the state occurred this is due to the boiling point (temperature in which the substance changes from liquid to gas) and the melting point (temperature in which the substance changes from solid to liquid)

Here is the graph based on the information:

Note: This question is incomplete because the observations are missing; here is the missing information.

Time (Minutes)Observations

0:00 Hydrogen is a solid at −263 °C. Heat is added to the sample.

2:43 Hydrogen begins to change into a liquid at −259 °C.

6:15 Temperature of the liquid begins to increase.

10:36 Hydrogen begins to form a gas at −253 °C.

14:01 Temperature of the gas begins to increase.

18:00 Final temperature of hydrogen gas is −245 °C.

Learn more about heat in: https://brainly.com/question/1429452

The water cycle, also known as the hydrologic cycle, is the continuous movement of water on, above, and below the surface of the Earth.

The water cycle involves a series of physical processes, including evaporation, condensation, precipitation, and runoff, that work together to move water from one location to another and to maintain the balance of water on Earth.

The water cycle begins when water from oceans, lakes, rivers, and other bodies of water evaporates into the atmosphere due to the heat from the sun. As water vapor rises into the atmosphere, it cools and condenses into clouds. When the clouds become saturated with water vapor, precipitation occurs in the form of rain, snow, sleet, or hail.

Learn more about water cycle:https://brainly.com/question/31195929

#SPJ1

Answer:

"The distance the spring stretches " is the correct option.

Explanation:

The Hooke's law for a spring is given by :

\(F_{spring}=-k\Delta x\)

Where

k is spring constant in N/m

\(\Delta x\) is the compression or stretching in the spring

Hence, the correct option for \(\Delta x\) is (b) "the distance the spring stretches .

The distance the spring stretches  is the correct option.

\(F_{spring} = -k\Delta x\)

here

K represent the spring constant

\(\Delta x\) represent the compression or stretching in the spring

Therefore, second option is correct.

Learn more: https://brainly.com/question/1605083?referrer=searchResults

The correct option for the catalyzed decomposition for given dinitrogen monoxide are- A. 1, 2, and 4

Nitrous oxide, also referred to as laughing gas, nitrous, simply nos, is a chemical substance that has the formula N2O and is also known as dinitrogen oxide as well as dinitrogen monoxide.

The fundamental procedures for dinitrogen monoxide's catalyzed breakdown are:

N2O (g) + NO (g) → N2 (g) + NO2 (g)

2 NO2 (g) → 2 NO (g) + O2 (g)

Thus, the correct statements are-

1. The overall balanced reaction is 2 N2O (g) → 2 N2 (g) + O2 (g).

2. NO (g) is a catalyst for the reaction.

4. NO2 (g) is a reaction intermediate.

Therefore, A. 1, 2, and 4 is the correct option.

To know more about the dinitrogen monoxide, here

https://brainly.com/question/25758887

#SPJ1

The statement is correct. The photoelectric effect refers to the phenomenon where electrons are ejected from the surface of a material when it is exposed to light. The frequency of light striking an electron in a metal must be above the threshold frequency in order for the photoelectric effect to occur.

The statement is correct. The photoelectric effect refers to the phenomenon where electrons are ejected from the surface of a material when it is exposed to light. However, for the photoelectric effect to occur, the frequency of the incident light must be above a certain threshold frequency.

The threshold frequency is the minimum frequency of light required to dislodge electrons from the material. Below this threshold frequency, regardless of the intensity or duration of the light, no electrons will be emitted.

This behavior can be explained by the particle-like nature of light, where light is composed of discrete packets of energy called photons. The energy of a photon is directly proportional to its frequency. Only photons with energy greater than or equal to the binding energy of the electrons in the material can dislodge them.

Therefore, the frequency of light striking an electron in a metal must be above the threshold frequency in order for the photoelectric effect to occur.

For more question on photoelectric

https://brainly.com/question/1458544

#SPJ8

Answer:

It's A: Weak & Vulnerable

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Answer:

Force F = 20N .

Mass m = 2.0 kg

Initial velocity u = 0

acceleration, a = 10m/s  

2

t = 1 sec.

Now Refer to the attachment, See the free body diagram of the block.

Force works on the block:-

Weight, W = mg

W = 2 × 10

W = 20N (which is Downward)  

Normal force N = mg cos37

N = 20 × 0.80  

N = 16 N. (perpendicular & upward to the plane )

Here Applied Force, P = 20N (which is down along the plane)

Now For Final Speed, We know the formula:-

v = u + at

v = 0 + 10 × 1

v = 10 m/s

the Distance travelled s = ut + 0.5 at×t

s = 0 + 0.5 ×10×1×1

s = 5 m.

Now,

(a)     So work done by the force of gravity in 1 sec. = F × d

             ⇒20 N × 5m      

             ⇒100 J.

(b) Here the weight act as downward, so distance travelled in downward.

             ⇒5 × sin37

             ⇒5 × 0.6  

             ⇒3 m.

so work done by gravity,

               ⇒20 N × 3 m

              ⇒60 J.

(c) Now, work done by all the forces  

               ⇒change in Kinetic energy

  ⇒

2

1  m(v2

−u  2

)

⇒0.5×2.0×(10  2

−0  2  )

⇒ 100 J.

⇒W.D by frictional force  

                 = work was done by all forces -( work was done by Normal force + work done by applied force + work done by gravity )  

                 = 100 J - (100 + 60 +0 )

                 = 100 - 1

     Hope this helps you≅        

Answer: metal turn orange and weaker as it gets oxidised

Explanation: